Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Classification | Analytical chemistry >> Analytical reagent >> Ion chromatography reagent |
|---|---|
| Name | (1S,2R,5S)-2-Isopropenyl-5-Methylcyclohexanol |
| Synonyms | (+)-Isopulegol; (1S,2R,5S)-2-Isopropenyl-5-methylcyclohexanol; (1S,3S,4R)-p-Menth-8-en-3-ol |
| Molecular Structure |  |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| CAS Registry Number | 104870-56-6 |
| SMILES | O[C@@H]1[C@@H](/C(=C)C)CC[C@H](C)C1 |
| InChI | 1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m0/s1 |
| InChIKey | ZYTMANIQRDEHIO-AEJSXWLSSA-N |
| Density | 0.913g/cm3 (Cal.) |
|---|---|
| Boiling point | 196.954°C at 760 mmHg (Cal.) |
| Flash point | 78.333°C (Cal.) |
| Refractive index | 1.472 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1S,2R,5S)-2-Isopropenyl-5-Methylcyclohexanol |