Online Database of Chemicals from Around the World
|
CAS#: 106571-12-4 Product: (4R,5R)-4,5-Bis[(4R)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]-1,3,2-Dioxathiolane 2,2-Dioxide No suppilers available for the product. |
| Name | (4R,5R)-4,5-Bis[(4R)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]-1,3,2-Dioxathiolane 2,2-Dioxide |
|---|---|
| Synonyms | D-mannitol 1,2:5,6-diacetonide 2,3-cyclic sulfate |
| Molecular Structure | ![CAS#: 106571-12-4, (4R,5R)-4,5-Bis[(4R)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]-1,3,2-Dioxathiolane 2,2-Dioxide](/moreStructures/106571-12-4.gif) |
| Molecular Formula | C12H20O8S |
| Molecular Weight | 324.35 |
| CAS Registry Number | 106571-12-4 |
| SMILES | O=S1(=O)O[C@@H]([C@H](O1)[C@@H]2OC(OC2)(C)C)[C@@H]3OC(OC3)(C)C |
| InChI | 1S/C12H20O8S/c1-11(2)15-5-7(17-11)9-10(20-21(13,14)19-9)8-6-16-12(3,4)18-8/h7-10H,5-6H2,1-4H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | QAUBTIDRQZLYPJ-ZYUZMQFOSA-N |
| Density | 1.334g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.465°C at 760 mmHg (Cal.) |
| Flash point | 205.066°C (Cal.) |
| Refractive index | 1.493 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4R,5R)-4,5-Bis[(4R)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]-1,3,2-Dioxathiolane 2,2-Dioxide |