CAS#: 109785-99-1 Product: Panasinsanol B No suppilers available for the product. |
Name | Panasinsanol B |
---|---|
Synonyms | Panasinsanol B |
Molecular Structure | ![]() |
Molecular Formula | C15H26O |
Molecular Weight | 222.37 |
CAS Registry Number | 109785-99-1 |
SMILES | [C@@H]13CC[C@@]2(C1(C(CCC2)(O)C)CC3(C)C)C |
InChI | 1S/C15H26O/c1-12(2)10-15-11(12)6-9-13(15,3)7-5-8-14(15,4)16/h11,16H,5-10H2,1-4H3/t11-,13+,14?,15?/m0/s1 |
InChIKey | ZEQZCZRDJPTCHI-MWTAGDMHSA-N |
Density | 1.013g/cm3 (Cal.) |
---|---|
Boiling point | 250.564°C at 760 mmHg (Cal.) |
Flash point | 103.346°C (Cal.) |
Market Analysis Reports |
List of Reports Available for Panasinsanol B |