Online Database of Chemicals from Around the World
| Name | 1,2,3,4,5,6,7,8-Octamethyltricyclo[4.2.0.02,5]Octa-3,7-Diene |
|---|---|
| Synonyms | Nsc148905; Tricyclo[4.2.0.02,5]Octa-3,7-Diene, 1,2,3,4,5,6,7,8-Octamethyl-; Tricyclo[4.2.0.0(2,5)]Octa-3,7-Diene, 1,2,3,4,5,6,7,8-Octamethyl- |
| Molecular Structure | ![CAS#: 1448-74-4, 1,2,3,4,5,6,7,8-Octamethyltricyclo[4.2.0.02,5]Octa-3,7-Diene](/moreStructures/1448-74-4.gif) |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 |
| CAS Registry Number | 1448-74-4 |
| SMILES | CC13C(C2(C(=C(C12C)C)C)C)(C(=C3C)C)C |
| InChI | 1S/C16H24/c1-9-10(2)14(6)13(9,5)15(7)11(3)12(4)16(14,15)8/h1-8H3 |
| InChIKey | MDRPLQOFHRSPDP-UHFFFAOYSA-N |
| Density | 0.977g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.123°C at 760 mmHg (Cal.) |
| Flash point | 93.696°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,6,7,8-Octamethyltricyclo[4.2.0.02,5]Octa-3,7-Diene |
