Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-[Difluoro(Trimethylsilyl)Methyl]Aniline |
|---|---|
| Synonyms | 3-[Difluor(trimethylsilyl)methyl]anilin; 3-[Difluoro(trimethylsilyl)methyl]aniline |
| Molecular Structure | ![CAS#: 223683-81-6, 3-[Difluoro(Trimethylsilyl)Methyl]Aniline](/moreStructures/223683-81-6.gif) |
| Molecular Formula | C10H15F2NSi |
| Molecular Weight | 215.32 |
| CAS Registry Number | 223683-81-6 |
| SMILES | C[Si](C)(C)C(c1cccc(c1)N)(F)F |
| InChI | 1S/C10H15F2NSi/c1-14(2,3)10(11,12)8-5-4-6-9(13)7-8/h4-7H,13H2,1-3H3 |
| InChIKey | BUIJCBOSNIIPTB-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.8±40.0°C at 760 mmHg (Cal.) |
| Flash point | 107.9±27.3°C (Cal.) |
| Refractive index | 1.477 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[Difluoro(Trimethylsilyl)Methyl]Aniline |