Online Database of Chemicals from Around the World
|
CAS#: 75363-85-8 Product: 3,5,12-Trihydroxy-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydro-1-tetracenyl 3-amino-2,3,6-trideoxyhexopyranoside No suppilers available for the product. |
| Name | 3,5,12-Trihydroxy-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydro-1-tetracenyl 3-amino-2,3,6-trideoxyhexopyranoside |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C25H27NO9 |
| Molecular Weight | 485.48 |
| CAS Registry Number | 75363-85-8 |
| SMILES | O=C2c1c(O)c5c(c(O)c1C(=O)c3cccc(OC)c23)CC(O)CC5OC4OC(C(O)C(N)C4)C |
| InChI | 1S/C25H27NO9/c1-9-21(28)13(26)8-16(34-9)35-15-7-10(27)6-12-18(15)25(32)20-19(23(12)30)22(29)11-4-3-5-14(33-2)17(11)24(20)31/h3-5,9-10,13,15-16,21,27-28,30,32H,6-8,26H2,1-2H3 |
| InChIKey | PILBYTNNIUDJPF-UHFFFAOYSA-N |
| Density | 1.563g/cm3 (Cal.) |
|---|---|
| Boiling point | 735.162°C at 760 mmHg (Cal.) |
| Flash point | 398.412°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,12-Trihydroxy-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydro-1-tetracenyl 3-amino-2,3,6-trideoxyhexopyranoside |