Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Rabeprazole EP Impurity G |
|---|---|
| Synonyms | 2-[(4-methoxy-3-methylpyridin-2-yl)methylsulfanyl]-1H-benzimidazole |
| Molecular Structure | ![CAS # 102804-82-0, Rabeprazole EP Impurity G, 2-[(4-methoxy-3-methylpyridin-2-yl)methylsulfanyl]-1H-benzimidazole](/structures/102804-82-0.gif) |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.36 |
| CAS Registry Number | 102804-82-0 |
| SMILES | CC1=C(C=CN=C1CSC2=NC3=CC=CC=C3N2)OC |
| Solubility | 14.59 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.678, Calc.* |
| Melting point | 214.17 ºC |
| Boiling Point | 503.36 ºC, 504.7±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 259.0±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Rabeprazole EP Impurity G |