Online Database of Chemicals from Around the World
| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (25) 5207-8417 +86 17714198479 | |||
 |
sales@fine-chemtech.com | |||
 |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | alpha,alpha,alpha,alpha',alpha'-Pentafluoro-o-xylene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C8H5F5 |
| Molecular Weight | 196.12 |
| CAS Registry Number | 312-95-8 |
| EC Number | 206-234-1 |
| SMILES | C1=CC=C(C(=C1)C(F)F)C(F)(F)F |
| Solubility | 68.08 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.399, Calc.* |
| Melting point | -52.86 ºC |
| Boiling Point | 123.10 ºC, 150.3±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 46.2±12.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for alpha,alpha,alpha,alpha',alpha'-Pentafluoro-o-xylene |