|
Chloroquine diphosphate
|
|
|
Identification |
|
Name |
|
Chloroquine diphosphate |
|
Synonyms |
|
N-(7-Chloro-4-quinolinyl)-N,N-dimethyl-1,4-pentanediamine diphosphate salt |
 |
|
Molecular Structure |
|
 |
|
|
Molecular Formula |
|
C18H26ClN3.2(H3PO4);C18H32ClN3O8P2 |
|
Molecular Weight |
|
515.87 |
|
CAS Registry Number |
|
50-63-5 |
|
EINECS |
|
200-055-2 |
| |
|
|
|
Properties |
|
|
Melting point |
|
200 ºC |
| |
|
|
|
Safety Data |
|
|
Hazard Symbols |
|
Xn Details |
|
Risk Codes |
|
R22 Details |
|
Safety Description |
|
S22;S24/25 Details |
| |
|
|
|
List of Suppliers |
|
|
The Complete List of Suppliers for Chloroquine diphosphate |
|
|
|
|
|