|
|
|
|
Identification |
|
Name |
|
 |
|
Synonyms |
|
 |
|
Chinese Names |
|
 |
 |
|
Molecular Structure |
|
 |
|
|
Molecular Formula |
|
C23H30ClN3O.2(HCl).2(H2O) |
|
Molecular Weight |
|
508.92 |
|
CAS Registry Number |
|
6151-30-0 |
| |
|
|
|
Properties |
|
|
Melting point |
|
247-250 ºC |
|
Water solubility |
|
2.8 g/100 mL |
| |
|
|
|
Safety Data |
|
|
Hazard Symbols |
|
Xn Details |
|
Risk Codes |
|
R22;R36/37/38 Details |
|
Safety Description |
|
S26;S37/39 Details |
| |
|
|
|
Suppliers in China |
|
The Complete List of Chinese Suppliers for  |
|
|
|
|
|
