Online Database of Chemicals from Around the World Search | Submit | Advertising | Forum | Chinese Page

chemBlink >> Supplier Listing >> C >> Chemrio International Limited
 




Chemrio International Limited

Company Name: Chemrio International Limited
Company's URL: www.chemrio.com
Phone Number: +86 (574) 2789-1263 / 2789-1269 / +86 18667892864
Thanks for referring to chemBlink when calling supplier.
Fax Number: +86 (574) 2789-1266
Email Address: info@chemriotech.com,lalita.tang@chemriotech.com
Location: China
Business Type: Chemical manufacturer
Membership: chemBlink premium supplier since 2012
Contact the Supplier:
Reply Email: 
Company Name: 
Contact Name: 
Contact Phone: 
Country/Area: 
Products Wanted: 
CAS Related: 
Quantity Needed: 
Purity Required: 
 
Products Supplied (asterisk denotes company's recommended products):
Product Name CAS Registry Number
2-Amino-4-chlorobenzoic acid * 89-77-0 Inquire
2-Chloro-3-methylpyrazine * 95-58-9 Inquire
Methyl 2-fluoro-2-methylpropionate * 338-76-1 Inquire
4-Fluoro-1-iodo-2-nitrobenzene * 364-77-2 Inquire
5-Fluoro-2-methylphenol * 452-85-7 Inquire
1-Iodo-3,3,3-trifluoropropane * 460-37-7 Inquire
3'-Hydroxyacetanilide * 621-42-1 Inquire
3-Fluoro-4-iodobenzoic acid * 825-98-9 Inquire
1H-Imidazole-4-carboxylic acid * 1072-84-0 Inquire
1-Methyl-1H-pyrazol-5-ylamine * 1192-21-8 Inquire
4-Amino-7H-pyrrolo[2,3-d]pyrimidine * 1500-85-2 Inquire
5-Chloro-2,1,3-benzothiadiazole * 2207-32-1 Inquire
Benzenecarbothioamide * 2227-79-4 Inquire
3'-Chloro-4'-fluoroacetophenone * 2923-66-2 Inquire
2-Oxobutanoic acid methyl ester * 3952-66-7 Inquire
Disodium 8-amino-1,3,6-naphthalenetrisulfonate * 5398-34-5 Inquire
4-Amino-3-nitrobenzonitrile * 6393-40-4 Inquire
N-(3-Chloropropyl)morpholine * 7357-67-7 Inquire
(Phenylsulfonyl)acetonitrile * 7605-28-9 Inquire
6-Quinolinecarboxylic acid * 10349-57-2 Inquire
6-(Trifluoromethyl)indole * 13544-43-9 Inquire
5-Methyl-2-thiophenecarboxaldehyde * 13679-70-4 Inquire
5-Amino-3-methylisoxazole * 14678-02-5 Inquire
5-Amino-1-(4-methoxyphenyl)-1H-pyrazole-4-carboxylic acid * 14678-95-6 Inquire
1H-Benzimidazole-5-carboxylic acid * 15788-16-6 Inquire
2,6-Difluoronitrobenzene * 19064-24-5 Inquire
3,4,5-Trichlorobromobenzene * 21928-51-8 Inquire
2-Chloro-4-trifluoromethylbenzoic acid * 23228-45-7 Inquire
4-Chloro-8-(trifluoromethyl)quinoline * 23779-97-7 Inquire
4-(4-Fluorobenzoyl)piperidine hydrochloride * 25519-78-2 Inquire
3-Nitro-1H-pyrazole * 26621-44-3 Inquire
4-Methyl-2,1,3-benzoxadiazole * 29091-40-5 Inquire
2,3,3-Trimethyl-5-methoxy-3H-indole * 31241-19-7 Inquire
2,6-Dichloroisonicotinonitrile * 32710-65-9 Inquire
3-(Trifluoromethyl)-4-bromobenzaldehyde * 34328-47-7 Inquire
2,6-Dichloro-4-methylpyridine * 39621-00-6 Inquire
alpha-Methyl-2-pyridinemethanamine hydrochloride * 40154-81-2 Inquire
(2,4-Dichloro-5-isopropoxyphenyl)hydrazine * 40178-22-1 Inquire
4-Hydroxyindan-1-one * 40731-98-4 Inquire
2-Amino-4-bromophenol * 40925-68-6 Inquire
1-Methyl-1H-imidazole-4-carboxylic acid * 41716-18-1 Inquire
Ethyl 2-bromothiazole-5-carboxylate * 41731-83-3 Inquire
2,4,6-Trichloro-5-pyrimidinecarboxaldehyde * 50270-27-4 Inquire
2-Bromo-4-chlorophenylacetic acid * 52864-56-9 Inquire
Methyl 2-(3-chlorophenyl)acetate * 53088-68-9 Inquire
4-Amino-2-fluorobenzonitrile * 53312-80-4 Inquire
3-Ethoxy-4-methoxybenzonitrile * 60758-86-3 Inquire
2-Fluoro-4-nitrobenzotrifluoride * 69411-67-2 Inquire
4-Chlorosulfonylbenzoic acid methyl ester * 69812-51-7 Inquire
3-Bromopyridine-4-carboxaldehyde * 70201-43-3 Inquire
More products...    www.chemrio.com
First  Previous  1  2  Next  Last 





www.chemietek.com www.chemilan.com www.chemimpex.com www.chemipanda.com www.chem-is-try.com www.chemizon.com www.chemleap.com www.chemlexpharma.com www.chemmaker.com www.chemmax.com.cn www.chemodex.com www.chemoki.com www.chemoraga.com www.chemorganic.com www.chemos.cz www.chemos-group.com www.chempacific.com www.chempep.com www.chemper.it www.chemproduct.ru www.chempur.de www.chemsampco.com www.chemshuttle.com www.chemsoon.com www.chemspecial.com www.chemstarindia.com www.chemstep.com www.chemstock.com www.chemstorm.com

Copyright ©  chemBlink. All rights reserved. Content Disclaimer | About chemBlink | Contact