| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 68186-38-9 | 1-Eicosanol, Phosphate, Sodium Salt | C20H43NaO5P |
| 68186-39-0 | Phosphoric Acid, Butyl 2-Ethoxyethyl Ester | C8H19O5P |
| 68186-45-8 | Phosphoric Acid, Decyl Octyl Ester | C16H35O4P |
| 68186-53-8 | (Z)-N,N-Bis(2-Hydroxyethyl)-9-Octadecenamide Phosphate (Ester) | C22H44NO6P |
| 68186-54-9 / 68400-72-6 | Methyl-Oxirane Polymer With Oxirane (E)-2-Butenedioate | C9H14O6 |
| 68186-55-0 | 3-[2-Hydroxy-3-[(9Z,11Z)-Octadeca-9,11-Dienoyl]Oxy-Propoxy]Carbonylbenzoic Acid | C29H42O7 |
| 68186-56-1 | Phosphoric Acid, Isooctyl Ester, Sodium Salt | C8H19NaO5P |
| 68186-58-3 | 1,3-Benzenedicarboxylic Acid, Polymer With 2-(Hydroxymethyl)-2-Methyl-1,3-Propanediol, Nonanoate | C22H34O8 |
| 68186-64-1 | Phosphoric Acid, 2-Ethylhexyl Ester, Sodium Salt | C8H17Na2O4P |
| 68186-70-9 | 2-Butenedioic Acid (2Z)-, Isodecyl Ester | C14H24O4 |
| 68186-81-2 | 1,2,4-Benzenetricarboxylic Acid, Ester With 1,2-Propanediol Phosphate | C12H13O10P |
| 68186-85-6 | C.I. Pigment Green 50 | |
| 68186-88-9 | C.I. Pigment Brown 33 | |
| 68186-89-0 | Pigment black 25 (C.I. 77332) | |
| 68186-90-3 | C.I. Pigment Brown 24 | |
| 68186-91-4 | C.I. Pigment Black 28 | |
| 68186-94-7 | C.I. Pigment Black 26 | Fe3Mn3O8 |
| 68186-97-0 | Pigment Black 27 | |
| 68187-00-8 | C.I.Pigment Black 24 | |
| 68187-11-1 | Pigment Blue 36 | |
| 68187-22-4 | Polyimidazoline, Quaternized | C14H24N4O4 |
| 68187-28-0 | 4,5-Bis(2-aminoethylamino)-1-(phenoxy)pentan-2-ol | C15H28N4O2 |
| 68187-29-1 | N-Cocoyl-L-glutamic acid, mono(triethanolamine) salt | C11H24N2O7 |
| 68187-30-4 / 16690-92-9 | L-Glutamic Acid, N-Coco Acyl Derivs., Disodium Salts | C5H7NNa2O4 |
| 68187-32-6 | Disodium 2-aminopentanedioate | C5H7NNa2O4 |
| 68187-51-9 | C.I. Pigment Yellow 119 | |
| 68187-52-0 | C14-18-Alkyl alcohol ethoxylated Sulfate Sodium Salt | C18H37NaO5S |
| 68187-53-1 | C.I. Pigment Red 236 | |
| 68187-58-6 | Pitch, petroleum | |
| 68187-76-8 | Castor oil, sulfated, sodium salt | |
| 68187-89-3 | Cocoyl chloride | |
| 68188-03-4 | Oils, Cabreuva | |
| 68188-12-5 | Perfluoro-C2-18-alkylethyl iodides | C4H4F5I.(C2F4)n |
| 68188-27-2 | Tall oil fatty acid pentaerythritol esters | |
| 68188-30-7 | Amides, Soya, N-[3-(Dimethylamino)Propyl] | |
| 68188-31-8 | Acid Chlorides, Soya, Reaction Products With Protein Hydrolyzates, Sodium Salts | |
| 68188-37-4 | Undecylenic Acid, Animal Protein Condensate | |
| 68188-38-5 | Sodium Coco-Hydrolyzed Animal Protein | |
| 68188-63-6 | Rosin, Maleated, Polymer With Bisphenol A And Formaldehyde | |
| 68188-68-1 | Fatty Acids, Tall-Oil, Polymers With Coconut Oil, Glycerol And Phthalic Anhydride | |
| 68188-85-2 | Rare earth fluorides | |
| 68188-88-5 | Rare earth chlorides | |
| 68188-98-7 | 5-Butyl-5-Ethyldihydrofuran-2(3H)-One | C10H18O2 |
| 68188-99-8 | 4-Tert-Butylphenol, 4-Nonylphenol, Formaldehyde, Oxirane, Methyloxirane Polymer | C31H50O5 |
| 68189-01-5 | 2,2',2''-Nitrilotris[ethanol] 2-ethylhexyl phosphate (salt) | C8H18O.x(C6H15NO3).x(H3PO4) |
| 68189-08-2 / 100-89-0 | 2-[1,1-dimethyl-3-[(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)oxy]butoxy]-4,4,6-trimethyl-1,3,2-dioxaborinane | C18H36B2O6 |
| 68189-10-6 | N-[2-[(2-Hydroxyethyl)Amino]Ethyl]Isooctadecanamide Hydroxyacetate | C24H50N2O4 |
| 68189-17-3 | 2-Hydroxy-Benzoic Acid Polymer With Formaldehyde And 2-Methylphenol | C15H16O5 |
| 68189-19-5 | 4-(1,1-Dimethylethyl)-2,3-Dimethylphenol | C12H18O |
| 68189-20-8 | 2-Tert-Butyl-3,6-Xylenol | C12H18O |