Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 86042-50-4 | N,N'-Bis[(benzyloxy)carbonyl]-N,N'-bis(2,4-dibromo-6-{[cyclohexyl(methyl)amino]methyl}phenyl)-L-cystinamide | C50H60Br4N6O6S2 |
| 86042-51-5 | Calcium 2-hydroxypropanoate hydrate (1:2:5) | C6H20CaO11 |
| 86042-82-2 | Tributylmethylphosphonium tetrafluoroborate | C13H30P.BF4 |
| 86044-59-9 | 2-(1,3-Benzodioxol-5-ylmethylene)hydrazinecarboximidamide | C9H10N4O2 |
| 86044-76-0 | N-Ac-Trp(1)-(4-Cl-Phe)(2)-Trp(3)-Arg(6)-Ala(10)-Lhrh | C71H94ClN19O13 |
| 86047-14-5 | 10-Methyl-8H-benzo[b]pyrido[4,3,2-de][1,8]phenanthroline-8,11(10H)-dione | C19H11N3O2 |
| 86047-53-2 | 2-(Isopropylsulfanyl)ethyl methacrylate | C9H16O2S |
| 86048-40-0 | Quazolast | C12H7ClN2O3 |
| 86048-54-6 | 4-Methyl-7-(2-Oxo-Cyclohexyloxy)-Chromen-2-One | |
| 86050-32-0 | Dimethylsilylbis(cyclopentadienyl)zirconium dichloride | C12H14Cl2SiZr |
| 86050-77-3 | Gadopentetate dimeglumine | C14H20GdN3O10.2(C7H17NO5) |
| 86050-92-2 | Ethyl 1-(chlorocarbonyl)-L-prolinate | C8H12ClNO3 |
| 86051-75-4 | 1,2-Dimethyl-5-(tributylstannyl)-1H-imidazole | C17H34N2Sn |
| 86052-04-2 | 3-Methylthiofentanyl | C21H28N2OS |
| 86052-06-4 | N-{1-[2-(1,3-Dioxan-2-yl)ethyl]-3-methyl-4-piperidinyl}-N-phenylpropanamide | C21H32N2O3 |
| 86052-56-4 | N-(2-Thien-2-Ylethyl)-N-(Thien-2-Ylmethyl)Amine | C11H13NS2 |
| 86053-95-4 | Amino(3,4,5-trimethoxyphenyl)acetic acid hydrochloride (1:1) | C11H16ClNO5 |
| 86053-97-6 | Amino(3,4,5-trimethoxyphenyl)acetic acid | C11H15NO5 |
| 86060-81-3 | Fmoc-S-acetamidomethyl-L-cysteine | C21H22N2O5S |
| 86060-82-4 | N'-Fmoc-N-Cbz-L-Lysine | C29H30N2O6 |
| 86060-83-5 | Fmoc-L-Aspartic acid-1-benzyl ester | C26H23NO6 |
| 86060-84-6 | Fmoc-L-aspartic acid 4-benzyl ester | C26H23NO6 |
| 86060-85-7 | Fmoc-glycine pentafluorophenyl ester | C23H14F5NO4 |
| 86060-86-8 | Fmoc-L-alanine pentafluorophenyl ester | C24H16F5NO4 |
| 86060-87-9 | N-(9-Fluorenylmethoxycarbonyl)-L-valine pentafluorophenyl ester | C26H20F5NO4 |
| 86060-88-0 | Fmoc-L-leucine pentafluorophenyl ester | C27H22F5NO4 |
| 86060-89-1 | N-(Fluorenylmethoxycarbonyl)isoleucine pentafluorophenyl ester | C27H22F5NO4 |
| 86060-90-4 | N-9-Fluorenylmethoxycarbonyl-L-proline pentafluorophenyl ester | C26H18F5NO4 |
| 86060-92-6 | Fmoc-L-phenylalanine pentafluorophenyl ester | C30H20F5NO4 |
| 86060-93-7 | N-9-Fluorenylmethoxycarbonyl-O-tert-butyltyrosine pentafluorophenyl ester | C34H28F5NO5 |
| 86060-94-8 | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-methionine pentafluorophenyl ester | C26H20F5NO4S |
| 86060-95-9 | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-S-(phenylmethyl)-L-Cysteine pentafluorophenyl ester | C31H22F5NO4S |
| 86060-96-0 | N-Fmoc-S-acetamidomethyl-L-cysteine pentafluorophenyl ester | C27H21F5N2O5S |
| 86060-98-2 | N-Fmoc-N'-Boc-L-lysine pentafluorophenyl ester | C32H31F5N2O6 |
| 86060-99-3 | Fmoc-L-asparagine pentafluorophenyl ester | C25H17F5N2O5 |
| 86061-00-9 | N-(9-Fluorenylmethoxycarbonyl)-L-glutamine pentafluorophenyl ester | C26H19F5N2O5 |
| 86061-01-0 | N-Fmoc-beta-tert-butyl-L-aspartic acid pentafluorophenyl ester | C29H24F5NO6 |
| 86061-03-2 | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-aspartic acid 1-(pentafluorophenyl) 4-(phenylmethyl) ester | C32H22F5NO6 |
| 86061-04-3 | N-(9-Fluorenylmethoxycarbonyl)-L-glutamic acid alpha-pentafluorophenyl gamma-tert-butyl ester | C30H26F5NO6 |
| 86061-05-4 | N-Fmoc-L-Serine Pentafluorophenyl Ester | |
| 86061-06-5 | N-Fmoc-L-Threonine Pentafluorophenyl Ester | |
| 86063-97-0 | Boc-Phe-Ala-Ala-4-Nitro-Phe-Phe-Val-Leu-Pyridin-4-Ylmethyl Ester | C55H71N9O12 |
| 86064-76-8 | N2-[N-[N-[3-(2-Furanyl)-1-oxo-2-propenyl]-L-phenylalanyl]-L-phenylalanyl]-L-arginine | C31H36N6O6 |
| 86065-51-2 | 1-(4-Cyanophenyl)urea | C8H7N3O |
| 86069-86-5 | (S)-1,2-Piperidinedicarboxylic acid 1-(9H-fluoren-9-ylmethyl) ester | C21H21NO4 |
| 86069-87-6 | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-tryptophan pentafluorophenyl este | C32H21F5N2O4 |
| 86070-23-7 | 5-Oxo-1,5-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonyl chloride | C6H3ClN4O2 |
| 86070-35-1 | (S)-2-Amino-4-(Methylamino)-4-Oxobutanoic Acid | |
| 86070-82-8 | 3-Hydroxypyrrolidine hydrochloride | C4H9NO.HCl |
| 86072-07-3 | 2-Chloro-1-Methyl-5-Nitro-Imidazole |