Products of Organic phosphine compound
| CAS No. | Product Name | Molecular Formula |
|---|
| 1002345-50-7 | 1,3-Bis(dicyclohexylphosphonium)propane bis(tetrafluoroborate) | C27H50P2.2(BF4).2H |
| 1017-60-3 | Bis(4-tolyl)phosphine | C14H15P |
| 101820-69-3 | Imidazo[1,2-a]pyridine-3-acetic acid ethyl ester | C11H12N2O2 |
| 1019-71-2 | Bis(4-methylphenyl)chlorophosphine | C14H14ClP |
| 102-85-2 | Tributyl phosphite | C12H27O3P |
| 1021176-69-1 | 5-(dicyclohexylphosphino)-1',3',5'-triphenyl-1,4'-Bi-1H-pyrazole | C36H39N4P |
| 10212-04-1 | (3-Bromophenyl)diphenylphosphine oxide | C18H14BrOP |
| 102691-36-1 | 2-Cyanoethyl N,N,N',N'-tetraisopropylphosphorodiamidite | C15H32N3OP |
| 10273-74-2 | p-Xylylenebis(Triphenylphosphonium Bromide) | C44H38P2 |
| 103099-52-1 | 1,3-Bis(dicyclohexylphosphino)propane | C27H50P2 |
| 1031-15-8 | Methyl triphenyl phosphonium chloride | C19H18ClP |
| 1031-93-2 | Diphenyl-4-tolylphosphine | C19H17P |
| 1034-39-5 | Dibromotriphenylphosphorane | C18H15Br2P |
| 1038-95-5 | Tris(4-methylphenyl)phosphine | C21H21P |
| 10526-80-4 | Phosphoenolpyruvic acid cyclohexylammonium salt | C6H13N.C3H5O6P |
| 1053657-14-9 | (2-Aminoethyl)diisopropylphosphine | C8H20NP |
| 105462-24-6 | Risedronic acid | C7H11NO7P2 |
| 1055888-89-5 | 3-[Bis(1,1-dimethylethyl)phosphino]-1-propanesulfonic acid | C11H25O3PS |
| 1065474-88-5 | (2S)-1-[(4R)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-2-(diphenylphosphino)ferrocene | C28H28FeNOP |
| 1066-50-8 | P-Ethyl-Phosphonic Dichloride | C2H5Cl2OP |
| 1066-51-9 | (Aminomethyl)phosphonic acid | CH6NO3P |
| 106678-35-7 | Bis(triphenylphosphine)cuprous nitrate | C36H30CuP2.NO3 |
| 1067-71-6 | Diethyl (2-oxopropyl)phosphonate | C7H15O4P |
| 1067-74-9 | Methyl diethylphosphonoacetate | C7H15O5P |
| 1068-07-1 | 1-Diethoxyphosphoryloctane | C12H27O3P |
| 1068-21-9 | (Amino-Ethoxyphosphoryl)Oxyethane | C4H12NO3P |
| 1069-08-5 | N,N-Diethyldichlorophosphoramidite | C4H10Cl2NP |
| 1079-66-9 | Chlorodiphenylphosphine | C12H10ClP |
| 1080-32-6 | Diethyl benzylphosphonate | C11H17O3P |
| 108756-88-3 | Dicyclohexylphosphine-borane | C12H23P.BH3 |
| 109552-15-0 | Disodium pamidronate | C3H9NNa2O7P2 |
| 1099-45-2 | Ethyl (triphenylphosphoranylidene)acetate | C22H21O2P |
| 1100-88-5 | Benzyltriphenylphosphonium chloride | C25H22P.Cl |
| 1101-41-3 | Di(Phenyl)Phosphanyl-Di(Phenyl)Phosphane | C24H20P2 |
| 110231-30-6 | Diphenyl-Pyren-1-Yl-Phosphane | C28H19P |
| 1111-92-8 | Dimethylphosphinic chloride | C2H6ClOP |
| 1112-37-4 | Diethylphosphinic chloride | C4H10ClOP |
| 1121960-93-7 | Tri-tert-butylphosphine gold(i) bis(trifluoromethylsulfonyl)imide | C14H27AuF6NO4PS2 |
| 1136-89-6 | 1-Naphthyl phosphate | C10H9O4P |
| 113978-91-9 | Tributylphosphonium tetrafluoroborate | C12H27P.BF4.H |
| 115034-38-3 | Tris(2,5-dimethylphenyl)phosphine | C24H27P |
| 115436-72-1 | Sodium risedronate | C7H10NNaO7P2 |
| 115826-95-4 | [(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride | C44H32Cl2P2Pd |
| 1159-54-2 | Tri(4-chlorophenyl)phosphine | C18H12Cl3P |
| 116-17-6 | Triisopropyl phosphite | C9H21O3P |
| 116405-43-7 | Bis(triphenylphosphine)iminium trifluoroacetate | C36H30NP2.C2F3O2 |
| 1173020-99-9 | 2-Diphenylphosphinoethyl-functionalized silica gel | |
| 1173023-24-9 | Bis(3,5-di-tert-butyl-4-Methoxyphenyl)phosphine | |
| 117924-33-1 | Di-tert-butyl N,N-diethylphosphoramidite | C12H28NO2P |
| 118072-93-8 | Zoledronic acid | C5H10N2O7P2 |
| 1187-50-4 | L-Leucylglycylglycine | C10H19N3O4 |
| 1196707-11-5 | Chloro[2-(dicyclohexylphosphino)-2'-(N,N-dimethylamino))-1,1'-biphenyl]gold(I) | C26H36AuClNP |
| 119942-99-3 | Phosphoramidon disodium salt | C23H32N3Na2O10P |
| 1202865-21-1 | 2-[Bis(3,5-di-tert-butyl-4-Methoxyphenyl)phosphino]benzaldehyde | |
| 121099-07-8 | Triisopropylphosphonium Tetrafluoroborate | C9H22BF4P |
| 121268-17-5 | Alendronate sodium | C4H12NNaO7P2.3(H2O) |
| 1219080-77-9 | Bis(adamant-1-yl)(2-dimethylaminophenyl)phosphine | C28H40NP |
| 121954-50-5 | 1,2-Bis(di-tert-butylphosphinomethyl)benzene | C24H44P2 |
| 1220349-00-7 | tert-Butyldicyclohexylphosphonium tetrafluoroborate | C16H32BF4P |
| 1221901-53-6 | (11bR)-N-Benzyl-N-phenyldinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine | C33H24NO2P |
| 1237588-12-3 | Bis(adamant-1-yl)(2-morpholinophenyl)phosphine | C30H42NOP |
| 1246841-00-8 | (2S)-1-[(1S)-1-[Bis(1,1-dimethylethyl)phosphino]ethyl]-2-(dicyclohexylphosphino)ferrocene | C32H52FeP2 |
| 1247079-94-2 | P-Cyclohexyl-P-methylphosphinic acid aluminum salt | 3(C7H14O2P).Al |
| 124755-24-4 | Ethyl [Bis(2,2,2-Trifluoroethoxy)Phosphoryl]Acetate | C8H11F6O5P |
| 1259-35-4 | Tris(pentafluorophenyl)phosphine | C18F15P |
| 126429-21-8 | Diallyl N,N-diisopropylphosphoramidite | C12H24NO2P |
| 1265-03-8 | 4,5-Bisdiphenylphosphine-9,9-Dimethylxanthene | C39H32OP2 |
| 126683-99-6 | Bis(1-adamantyl)phosphinic chloride | C20H30ClOP |
| 127593-28-6 | ((S)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl)dichloropalladium | C44H32Cl2P2Pd |
| 130914-24-8 | Dicyclopentylphosphinous chloride | C10H18ClP |
| 131211-27-3 | Diadamantylphosphine | C20H31P |
| 131274-22-1 | Tri-tert-butylphosphine tetrafluoroborate | C12H28P.BF4 |
| 131322-08-2 | Tri-Tert-Butylphosphonium Tetraphenylborate | C36H47BP |
| 13138-33-5 | 3-Aminopropylphosphonic acid | C3H10NO3P |
| 13138-36-8 | (1-Aminobutyl)phosphonic acid | C4H12NO3P |
| 13138-37-9 | (1-Aminopentyl)Phosphonic Acid | C5H13NO3P |
| 132071-87-5 | Dichloro[(S)-(-)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium (II) | C44H32Cl2P2Ru |
| 13321-61-4 | 2-Oxo-3-(Triphenylphosphoranylidene)-Propanoic Acid Ethyl Ester | C23H21O3P |
| 13371-17-0 | Butyltriphenylphosphonium chloride | C22H24ClP |
| 13406-29-6 | Tris[4-(trifluoromethyl)phenyl]phosphine | C21H12F9P |
| 13433-42-6 | Dimethyl [(Trimethylsilyl)Methyl]Phosphonate | C6H17O3PSi |
| 135139-00-3 | (S)-(-)-2,2'-Bis[di(3,5-xylyl)phosphino]-1,1'-binaphthyl | C52H48P2 |
| 13689-19-5 | Tricyclohexylphosphine oxide | C18H33OP |
| 13689-20-8 | Cyclohexyldiphenyl-Phosphine Oxide | C18H21OP |
| 13716-10-4 | Di-tert-butylchlorophosphane | C8H18ClP |
| 13716-12-6 | Tri-tert-butylphosphine | C12H27P |
| 13716-45-5 | Diethyl Trimethylsilyl Phosphite | C7H19O3PSi |
| 137348-86-8 | Di-tert-butyl N,N-diisopropylphosphoramidite | C14H32NO2P |
| 137348-88-0 | N-[(Di(Propan-2-Yl)Amino)-[(2-Methylpropan-2-Yl)Oxy]Phosphanyl]-N-Propan-2-Ylpropan-2-Amine | C16H37N2OP |
| 137349-65-6 | Bis(dicyclohexylphosphino)methane | C25H46P2 |
| 138687-69-1 | Pentafluorophenyl diphenylphosphinate | C18H10F5O2P |
| 13885-09-1 | 2-(Diphenylphosphino)biphenyl | C24H19P |
| 13892-06-3 | 1,1,1-Trimethyl-N-(Triphenylphosphoranylidene)Silanamine | C21H24NPSi |
| 138926-19-9 | Ibandronate sodium | C9H22O7NP2Na |
| 1389309-54-9 | 1,1'-(1,4-Butanediyl)bis[1,1-dicyclohexylphosphine] tetrafluoroborate(1-) (1:2) | C28H52P2.2(BF4).2H |
| 13991-08-7 | 1,2-Bis(diphenylphosphino)benzene | C30H24P2 |
| 140-08-9 | Tris(2-chloroethyl) phosphite | C6H12Cl3O3P |
| 14047-23-5 | P-(1-Aminopropyl)-Phosphonic Acid | C3H9NO3P |
| 14126-40-0 | Bis(Triphenylphosphine)Cobalt (II) Chloride | C36H32Cl2CoP2 |
| 14221-02-4 | Tetrakis(triphenylphosphine)platinum | C72H60P4Pt |
| 142421-57-6 | P,P-Bis[3,5-Bis(Trifluoromethyl)Phenyl]-Phosphinous Chloride | C16H6ClF12P |
| 14254-41-2 | Bis(2,4-dichlorophenyl) chlorophosphate | C12H6Cl5O3P |
| 142691-70-1 | 1,1'-Bis(dichlorophosphino)ferrocene | C10H8Cl4FeP2 |
| 1429-50-1 | Ethylenebis(nitrilodimethylene)tetraphosphonic acid | C6H20N2O12P4 |
| 1439-36-7 | 1-(Triphenylphosphoranylidene)acetone | C21H19OP |
| 1445085-97-1 | Xantphos Pd G3 | C52H45NO4P2PdS |
| 1449-46-3 | Benzyltriphenylphosphonium bromide | C25H22P.Br |
| 145650-60-8 | Bis(2,4-DI-tert-butyl-6-methyl phenyl) ethyl phosphite | C32H51O3P |
| 1474-78-8 | Ethyl diethoxyphosphinylformate | C7H15O5P |
| 1478-53-1 | Diethyl difluoromethanephosphonate | C5H11F2O3P |
| 14812-59-0 | 2-Chloro-4,4,5,5-tetramethyl-1,3,2-dioxaphospholane | C6H12ClO2P |
| 1486-28-8 | Diphenylmethylphosphine | C13H13P |
| 14866-43-4 | Hexadecyltriphenylphosphonium bromide | C34H48BrP |
| 14973-89-8 | Bromotris(triphenylphosphine)rhodium | C54H45BrP3Rh |
| 1498-40-4 | Dichloroethylphosphine | C2H5Cl2P |
| 1498-42-6 | Ethoxydichlorophosphine | C2H5Cl2OP |
| 1498-54-0 | N-dichlorophosphoryl-N-ethyl-ethanamine | C4H10Cl2NOP |
| 1499-17-8 | 2-Chloro-1,3-dioxa-2-phosphaindan 2-oxide | C6H4ClO3P |
| 1499-21-4 | Diphenylphosphinyl chloride | C12H10ClOP |
| 1499-29-2 | Bis(dichlorophosphoryl)methane | CH2Cl4O2P2 |
| 149968-36-5 | 1,3-Bis[(di-tert-butylphosphino)methyl]benzene | C24H44P2 |
| 15074-54-1 | Phosphorodichloridic acid 2-Chlorophenyl Ester | C6H4Cl3O2P |
| 15104-46-8 | 1,2-Bis(dimethoxyphosphoryl)benzene | C10H16O6P2 |
| 15171-48-9 | 2-Methyl-1,2-oxaphospholan-5-one 2-oxide | C4H7O3P |
| 1519-45-5 | 1,1'-(1,2-Ethanediyl)Bis[1,1,1-Triphenyl-Phosphonium Bromide (1:2) | C38H34I2P2 |
| 1519-47-7 | [1,4-Phenylenebis(methylene)]bis[triphenylphosphonium] dichloride | C44H38Cl2P2 |
| 15278-97-4 | Chloro(trimethylphosphine)gold | C3H9AuClP |
| 15294-63-0 | Tributyldodecylphosphonium bromide | C24H52P.Br |
| 1530-32-1 | Ethyltriphenylphosphonium bromide | C20H20BrP |
| 1530-43-4 | Benzhydryl Triphenylphosphonium Chloride | C31H26ClP |
| 153358-05-5 | 2-(Diphenylphosphino)benzaldehyde oxime | |
| 154862-43-8 | Doverphos 9228 | C53H58O6P2 |
| 15510-55-1 | Dodecyltriphenylphosphonium bromide | C30H40BrP |
| 15529-90-5 | Triethylphosphineaurous chloride | C6H15AuClP |
| 155648-60-5 | Minodronic acid | C9H12N2O7P2.H2O |
| 15573-31-6 | Propylphosphonous Dichloride | C3H7Cl2P |
| 15573-38-3 | Tris(Trimethylsilyl)-Phosphine | C9H27PSi3 |
| 155941-31-4 | (1S)-1-(Diphenylphosphino)-2-[(1R)-1-(diphenylphosphino)ethyl]ferrocene | C36H32FeP2 |
| 15596-07-3 | (Triphenylphosphoranylidene)ketene | C20H15OP |
| 15599-91-4 | Phosphonitrilic fluoride trimer | F6N3P3 |
| 1560-54-9 | Allyltriphenylphosphonium bromide | C21H20P.Br |
| 1571-33-1 | Phenylphosphonic acid | C6H7O3P |
| 157141-27-0 | (Cyanomethylene)tributylphosphorane | C14H28NP |
| 15715-41-0 | Methyldiethoxyphosphine | C5H13O2P |
| 15827-60-8 | Diethylenetriaminepenta(methylene-phosphonic acid) | C9H28N3O15P5 |
| 15909-92-9 | 3,3'-(Phenylphosphinidene)Bis-Propanenitrile | C12H13N2P |
| 1605-53-4 | Diethylphenylphosphine | C10H15P |
| 1608-26-0 | Hexamethylphosphorous triamide | C6H18N3P |
| 161265-03-8 | Dimethylbisdiphenylphosphinoxanthene | C39H32OP2 |
| 16165-68-7 | P-Decyl-Phosphonic Acid Diethyl Ester | C14H31O3P |
| 1636-14-2 | N,N,N',N'-Tetraethyl-P-Phenyl-Phosphonous Diamide | C14H25N2P |
| 1638-86-4 | Diethyl Phenyl-Phosphonite | C10H15O2P |
| 1641-40-3 | 2-Chloro-1,3,2-Benzodioxaphosphole | C6H4ClO2P |
| 164654-49-3 | N-[Bis(Phenylmethoxy)Phosphanyl]-N-Methylmethanamine | C16H20NO2P |
| 16523-54-9 | Dicyclohexylchlorophosphine | C12H22ClP |
| 16523-89-0 | Triallylphosphine | C9H15P |
| 1660-95-3 | Tetraisopropyl methylenediphosphonate | C13H30O6P2 |
| 16605-03-1 | 3-(Diphenylphosphino)-1-Propanamine | C15H18NP |
| 166172-69-6 | Bis[3,5-Bis(Trifluoromethyl)Phenyl]-Phosphine | C16H7F12P |
| 1663-45-2 | 1,2-Bis(diphenylphosphino)ethane | C26H24P2 |
| 166330-10-5 | Bis(2-diphenylphosphinophenyl) ether | C36H28OP2 |
| 16640-68-9 | Triphenylphosphoranylidenacetonitrile | C20H16NP |
| 16903-61-0 | Bis-(triphenylphosphino)-cuprous borohydride | 2(C18H15P).Cu.BH4 |
| 1698-60-8 | Chloridazon | C10H8ClN3O |
| 1702-42-7 | Tributylmethylphosphonium iodide | C13H30IP |
| 1707-03-5 | Diphenylphosphinic acid | C12H11O2P |
| 17154-34-6 | Diphenyl(trimethylsilyl)phosphine | C15H19PSi |
| 17261-28-8 | 2-(Diphenylphosphino)benzoic acid | C19H15O2P |
| 17261-34-6 | Imino-Bis(Methylphosphonic Acid) | C2H9NO6P2 |
| 1733-57-9 | Diphenyl(ethyl)phosphine oxide | C14H15OP |
| 173443-43-1 | Diethyl (4-Iodobenzyl)Phosphonate | C11H16IO3P |
| 173593-25-4 | Dicyclohexyl(2-methylphenyl)phosphine | C19H29P |
| 1746-03-8 | Vinylphosphonic acid | C2H5O3P |
| 174810-09-4 | (1R,2R)-(+)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl) | C52H44N2O2P2 |
| 175136-62-6 | Tris[3,5-Bis(Trifluoromethyl)Phenyl]-Phosphine | C24H9F18P |
| 1754-49-0 | Diethyl Phenylphosphonate | C10H15O3P |
| 17672-53-6 | Bis(2,2,2-Trichloroethyl) Phosphorochloridate | C4H4Cl7O3P |
| 17745-04-9 | Imidazo[1,2-a]pyridin-3-ylacetic acid | C9H8N2O2 |
| 1779-48-2 | Phenylphosphinic acid | C6H7O2P |
| 1779-51-7 | Butyltriphenylphosphonium bromide | C22H24P.Br |
| 17805-69-5 | Calcium 1-Naphthyl Phosphate | C10H7CaO4P |
| 17814-85-6 | (4-Carboxybutyl)triphenylphosphonium bromide | C23H24O2P.Br |
| 17857-14-6 | 3-Carboxypropyltriphenylphosphonium bromide | C22H22BrO2P |
| 18005-40-8 | O-Ethyl Methylphosphonothioate | C3H9O2PS |
| 181259-35-8 | Tetraphenylphosphonium Tetra-p-Tolylborate | C52H48BP |
| 1813-60-1 | Tetrabutylphosphonium Tetrafluoroborate | C16H36BF4P |
| 181864-78-8 | 2-Dicyclohexylphosphanylethyl-Trimethylazanium | C17H35NP |
| 18437-78-0 | Tris(4-fluorophenyl)phosphine | C18H12F3P |
| 18480-23-4 | Allyl triphenylphosphonium chloride | C21H20P.Cl |
| 187344-92-9 | Bis(3,5-dimethylphenyl)phosphine oxide | C16H19OP |
| 18812-51-6 | Diethyl propanephosphonate | C7H17O3P |
| 18868-46-7 | 2,2,2-Trichloroethyl Dichlorophosphate | C2H2Cl5O2P |
| 18896-56-5 | [(2-Methylphenyl)Methyl]-Phosphonic Acid | C8H9O3P |
| 193197-68-1 | Tris[4-(Tridecafluorohexyl)Phenyl]Phosphine | C36H12F39P |
| 1983-26-2 | P-(Chloromethyl)-Phosphonic Dichloride | CH2Cl3OP |
| 1983-27-3 | (Chloromethyl)Phosphonothioic Dichloride | CH2Cl3PS |
| 19845-69-3 | 1,6-Bis(diphenylphosphino)hexane | C30H32P2 |
| 2041-14-7 | (2-Aminoethyl)phosphonic acid | C2H8NO3P |
| 20434-05-3 | Bis(4-Methoxyphenyl)Phosphinic Acid | C14H15O4P |
| 20445-88-9 | Tributylmethylphosphonium dimethyl phosphate | C13H30P.C2H6O4P |
| 2049-55-0 | Borane triphenylphosphine complex | C18H18BP |
| 20592-85-2 | Sodium amino-tris(methylenesulphonate) | C3H8NNa4O9P3 |
| 2065-67-0 | Tetraphenylphosphonium iodide | C24H20P.I |
| 206860-46-0 | (1S,3S,4S)-3-Bromo-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonic acid hydrate | C10H15BrO4S.x(H2O) |
| 2071-20-7 | Bis(diphenylphosphino)methane | C25H22P2 |
| 2091-46-5 | Triphenylpropargylphosphonium bromide | C21H18P.Br |
| 20999-38-6 | (2-(9H-Carbazol-9-yl)ethyl)phosphonic acid | C14H14NO3P |
| 210169-54-3 | (S)-5,5'-Bis(diphenylphosphino)-4,4'-bibenzodioxole | C38H28O4P2 |
| 21050-13-5 | Bis(triphenylphosphine)iminium chloride | C36H30ClNP2 |
| 212713-08-1 | Bis[4-Methoxy-3,5-Bis(2-Methyl-2-Propanyl)Phenyl]Phosphinous Chloride | C30H46ClO2P |
| 2129-31-9 | 4-(Diphenylphosphino)benzoic acid | C19H15O2P |
| 2129-89-7 | Methyldiphenylphosphine oxide | C13H13OP |
| 2136-75-6 | (Triphenylphosphoranylidene)acetaldehyde | C20H17OP |
| 213697-53-1 | 2-Dicyclohexylphosphino-2'-(N,N-dimethylamino)biphenyl | C26H36NP |
| 2155-96-6 | Diphenylvinylphosphine | C14H13P |
| 215792-51-1 | Sulfoxantphos | C39H30O7P2S2Na2 |
| 21646-99-1 | Tetraethyl Pyrophosphite | C8H20O5P2 |
| 218281-19-7 | tri(4-Methylphenyl)phosphine | C21H21P |
| 2197-63-9 | Dicetyl phosphate | C32H67O4P |
| 22031-12-5 | 1,1,1-Tris(diphenylphosphinomethyl)ethane | C41H39P3 |
| 22036-77-7 | Sodium (ethylenediamine)tetramethylenephosphonate | C6H20N2O12P4.xNa |
| 22042-96-2 | Diethylenetriaminepenta(methylenephosphonicacid) sodium salt | C9H28N3O15P5.xNa |
| 221187-50-4 | 2'-(Dicyclohexylphosphino)acetophenone ethylene ketal | C22H33O2P |
| 2234-97-1 | Tripropylphosphine | C9H21P |
| 2235-43-0 | [Nitrilotris(methylene)]tris-phosphonic acid pentasodium salt | C3H7NNa5O9P3 |
| 2240-41-7 | Dimethyl phenylphosphonate | C8H11O3P |
| 224311-49-3 | 2-(Di-tert-butylphosphino)-2'-(N,N-dimethylamino)biphenyl | C22H32NP |
| 224311-51-7 | 2-(Di-tert-butylphosphino)biphenyl | C20H27P |
| 22560-50-5 | Dichloromethylenediphosphonic acid disodium salt | CH2Cl2Na2O6P2 |
| 22884-29-3 | (2-Methylpropyl)Triphenyl-Phosphonium Bromide (1:1) | C22H24BrP |
| 2302-80-9 | Butylphosphonic dichloride | C4H9Cl2OP |
| 23039-94-3 | Tri(3-fluorophenyl)phosphine | C18H12F3P |
| 2304-30-5 | Tetrabutylphosphonium chloride | C16H36ClP |
| 23176-18-3 | Bis(diphenylphosphino)methane oxide | C25H22OP2 |
| 2325-27-1 | N-(Triphenylphosphoranylidene)-Benzenamine | C24H20NP |
| 2327-69-7 | 4-(Diethoxyphosphinyl)-Butanoic Acid Ethyl Ester | C10H21O5P |
| 23273-82-7 | N-(3-Aminopropyl)-1,4-Butanediamine Phosphate Hydrate (2:3:6) | C14H59N6O18P3 |
| 2356-16-3 | Triethyl 2-fluoro-2-phosphonoacetate | C8H16FO5P |
| 23605-74-5 | Hexamethylenebis(nitrilodimethylene)tetraphosphonic acid | C10H28N2O12P4 |
| 23743-26-2 | 1,2-Bis(dicyclohexylphosphino)ethane | C26H48P2 |
| 2377770-18-6 | (2-(3,6-Dimethoxy-9H-carbazol-9-yl)ethyl)phosphonic acid | C16H18NO5P |
| 23783-26-8 | Hydroxyphosphono-acetic acid | C2H5O6P |
| 238403-28-6 | Poly(ethylene glycol) triphenylphosphine | |
| 23897-15-6 | Tris(2,4,6-trimethylphenyl)phosphine | C27H33P |
| 23906-97-0 | Tetraoctylphosphonium bromide | C32H68P.Br |
| 2404-55-9 | Trimethyl-Phosphine Sulfide | C3H9PS |
| 2404-73-1 | 1-(Butoxy-Methylphosphoryl)Oxybutane | C9H21O3P |
| 2404-75-3 | P-Butyl-Phosphonic Acid Diethyl Ester | C8H19O3P |
| 240417-00-9 | 2-Diphenylphosphino-2'-(N,N-dimethylamino)biphenyl | C26H24NP |
| 2409-61-2 | Bis(p-tolyl)phosphine oxide | C14H15OP |
| 24171-89-9 | Tris(2-thienyl)phosphine | C12H9PS3 |
| 244261-66-3 | [(4R)-[4,4'-Bi-1,3-benzodioxole]-5,5'-diyl]bis[diphenylphosphine] | C38H28O4P2 |
| 24470-78-8 | Isopropyltriphenylphosphonium iodide | C21H22P.I |
| 24720-64-7 | 2-(Triphenylphosphoranylidene)-Propionaldehyde | C21H19OP |
| 247940-06-3 | 2-(Dicyclohexylphosphino)biphenyl | C24H31P |
| 250285-32-6 | 1,3-Bis(2,6-diisopropylphenyl)imidazolium chloride | C27H37ClN2 |
| 2511-09-3 | O-Ethyl phenylphosphinate | C8H11O2P |
| 2511-17-3 | N,N,N',N',P-Pentamethyl-Phosphonic Diamide | C5H15N2OP |
| 2511-19-5 | Dimethyl-Phosphinic acid Ethyl Ester | C4H11O2P |
| 25235-15-8 | Isopropylphosphonous Dichloride | C3H7Cl2P |
| 2526-64-9 | Dichlorotriphenylphosphorane | C18H15Cl2P |
| 2537-48-6 | Diethyl cyanomethylphosphonate | C6H12NO3P |
| 255837-19-5 | 2-Di-tert-butylphosphino-2'-methylbiphenyl | C21H29P |
| 2574-25-6 | Diisopropyl chlorophosphate | C6H14ClO3P |
| 25791-20-2 | Triphenyltetradecyl-Phosphonium Bromide (1:1) | C32H44BrP |
| 258864-54-9 | Trihexyltetradecylphosphonium chloride | C32H68P.Cl |
| 25979-07-1 | tert-Butyldichlorophosphine | C4H9Cl2P |
| 26039-10-1 | Imidodiphosphoric Acid, Tetrasodium Salt | H5NO6P2 |
| 2605-67-6 | Methyl (triphenylphosphoranylidene)acetate | C21H19O2P |
| 261733-18-0 | 4,6-Bis(diphenylphosphino)phenoxazine | C36H27NOP2 |
| 2622-14-2 | Tricyclohexyl phosphine | C18H33P |
| 26305-75-9 | Tris(triphenylphosphine)cobalt chloride | C54H45ClCoP3 |
| 2650-44-4 | 1-naphthalenephosphonic acid | C10H10NaO5P |
| 26681-88-9 | Divinylphenylphosphine | C10H11P |
| 2741-38-0 | Allyldiphenylphosphine | C15H15P |
| 2747959-96-0 | [4-(3,6-Dimethyl-9H-carbazol-9-yl)butyl]phosphonic acid | C18H22NO3P |
| 2751-90-8 | Tetraphenylphosphonium bromide | C24H20BrP |
| 27661-42-3 | Bis(2,4,4-Trimethylpentyl)Phosphinic Acid | C16H35O2P |
| 2767-80-8 | Tris(hydroxymethyl)phosphine | C3H9O3P |
| 27721-02-4 | 1,5-Bis(diphenylphosphino)pentane | C29H30P2 |
| 27784-76-5 | tert-Butyl diethylphosphonoacetate | C10H21O5P |
| 27794-93-0 | Aminotrimethylenephosphonic acid potassium salt | C3H12NO9P3.xK |
| 2814500-04-2 | (4-(3,6-Diphenyl-9H-carbazol-9-yl)butyl)phosphonic acid | C28H26NO3P |
| 28240-68-8 | Bis(dichlorophosphino)methane | CH2Cl4P2 |
| 28240-69-9 | P,P'-1,2-Ethanediylbis-Phosphonous Dichloride | C2H4Cl4P2 |
| 2844-89-5 | P-Cyclohexyl-Phosphonous Dichloride | C6H11Cl2P |
| 28978-09-8 | Chloro(dimethylphenylphosphine)gold | C8H11AuClP |
| 29199-09-5 | 3',6'-Bis(Diethylamino)-2-(4-Nitrophenyl)Spiro[Isoindole-1,9'-Xanthene]-3-One | C34H34N4O4 |
| 2922526-56-3 | (4-(3,6-Dimethoxy-9h-carbazol-9-yl)butyl)phosphonic acid | C18H22NO5P |
| 29329-71-3 | 1-Hydroxyethanediphosphonic acid sodium salt | C2H8O7P2.xNa |
| 2946-61-4 | Dimethoxyphenylphosphine | C8H11O2P |
| 29949-69-7 | Chloro(Tert-Butyl)Phenylphosphine | C10H14ClP |
| 29949-72-2 | Di-t-butyl(n-butyl)phosphine | C12H27P |
| 29949-75-5 | Diallylphenylphosphine | C12H15P |
| 29949-84-6 | Tris(3-methoxyphenyl)phosphine | C21H21O3P |
| 29949-85-7 | Tris(3-chlorophenyl)phosphine | C18H12Cl3P |
| 29952-64-5 | Dimethyl diisopropylphosphoramidoite | C8H20NO2P |
| 30492-56-9 | Triethyl Phosphonoacetate | C8H17O5P |
| 3053-68-7 | Triphenylphosphine-triphenylborane | C36H30BP |
| 305808-24-6 | 2-Naphthyl Phosphate Calcium Salt | |
| 308103-66-4 | Dipotassium bis(p-sulfonatophenyl)phenylphosphine dihydrate | C18H15O6PS2.2(H2O).2K |
| 3084-40-0 | Diethyl (hydroxymethyl)phosphonate | C5H13O4P |
| 3115-66-0 | Tetrabutylphosphonium iodide | C16H36IP |
| 3115-68-2 | Tetrabutylphosphonium bromide | C16H36P.Br |
| 31227-45-9 | tetraTriphenylphosphineplatinum | C72H60P4Pt |
| 312959-24-3 | 1,2,3,4,5-Pentaphenyl-1'-(di-tert-butylphosphino)ferrocene | C48H47FeP |
| 314730-65-9 | 2-Chloro-1,3-Bis(2,6-Diisopropylphenyl)-1,3,2-Diazaphospholidine | C26H38ClN2P |
| 31618-90-3 | Diethyl (tosyloxy)methylphosphonate | C12H19O6PS |
| 31681-98-8 | beta-Naphthyl Phosphate, Disodium Salt | C10H8Na2O4P |
| 321921-71-5 | Butyldi-1-adamantylphosphine | C24H39P |
| 3277-27-8 | Diethyl Benzoylphosphonate | C11H15O4P |
| 32806-04-5 | Diethyl (MethoxyMethyl)phosphonate | |
| 3283-12-3 | Dimethylphosphinic Acid | C2H7O2P |
| 329003-65-8 | MonosodiuM Risedronate HeMipentahydrate | |
| 33027-66-6 | Ethoxy(pentafluoro)cyclotriphosphazene | C2H5F5N3OP3 |
| 33309-88-5 | Bis(tricyclohexylphosphine)palladium(0) | C36H66P2Pd |
| 3348-44-5 | Bis(dimethylamino)chlorophosphine | C4H12ClN2P |
| 3411-48-1 | Tri(1-naphthyl)phosphine | C30H21P |
| 34156-56-4 | Phosphonoformic acid trisodium salt hexahydrate | CH12Na3O11P |
| 3454-66-8 | Diethyl Dithiophosphate, Potassium Salt | C4H10KO2PS2 |
| 3462-95-1 | (4-Fluorobenzyl)Triphenylphosphonium Chloride | C25H21ClFP |
| 34690-00-1 | Bis(hexamethylenetriaminepenta(methylenephosphonic acid)) | C17H44N3O15P5 |
| 35657-77-3 | BHMT | C17H44N3O15P5 |
| 35835-94-0 | Ethyltriphenylphosphonium acetate | C20H20P.C2H3O2 |
| 36042-94-1 | Chlorodi(o-tolyl)phosphine | C14H14ClP |
| 36042-99-6 | Di(1-naphthyl)phosphine chloride | C20H14ClP |
| 36198-87-5 | Dimethyl Trimethylsilyl Phosphite | C5H15O3PSi |
| 3658-48-8 | Bis(2-ethylhexyl) phosphite | C16H35O3P |
| 3663-52-3 | Bis(Trimethylsilyl) Phosphite | C6H19O3PSi2 |
| 3676-97-9 | Tetramethylbiphosphine disulfide | C4H12P2S2 |
| 36802-41-2 | Bis(2-methoxyphenyl)phenylphosphine | C20H19O2P |
| 3699-66-9 | Triethyl 2-phosphonopropionate | C9H19O5P |
| 3699-67-0 | Triethyl 3-phosphonopropionate | C9H19O5P |
| 370-69-4 | Tris(2,2,2-trifluoroethyl) phosphite | C6H6F9O3P |
| 37002-48-5 | (+)-4,5-Bis(diphenylphosphinomethyl)-2,2-dimethyl-1,3-dioxolane | C31H32O2P2 |
| 3762-25-2 | 4-Methylbenzylphosphonic acid diethyl ester | C12H19O3P |
| 37632-18-1 | 4-Methoxyphenylphosphonic Dichloride | C7H7Cl2O2P |
| 3794-83-0 | (1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt | C2H4Na4O7P2 |
| 37943-90-1 | Diphenyl-2-pyridylphosphine | C17H14NP |
| 37971-36-1 | 2-Phosphonobutane-1,2,4-tricarboxylic acid | C7H11O9P |
| 38686-38-3 | Chloro(methyldiphenylphosphine) gold | C13H13AuClP |
| 3878-44-2 | Triphenylphosphine selenide | C18H15PSe |
| 3878-45-3 | Triphenylphosphine sulfide | C18H15PS |
| 38820-59-6 | HDTMP hexapotassium salt | C10H22K6N2O12P4 |
| 3913-50-6 | 2-Oxo-3-(phosphonooxy)propanoic acid | C3H5O7P |
| 395116-70-8 | Di(1-adamantyl)benzylphosphine | C27H37P |
| 3968-92-1 | (2-Butyl)Triphenylphosphonium Bromide | C22H24BrP |
| 3982-87-4 | Triisobutylphosphine sulfide | C12H27PS |
| 39864-68-1 | Dicyclopentylphosphine | C10H19P |
| 4020-99-9 | Diphenylmethoxyphosphine | C13H13OP |
| 4023-53-4 | Tris(2-cyanoethyl)phosphine | C9H12N3P |
| 40244-90-4 | Chlorodiisopropylphosphine | C6H14ClP |
| 40438-64-0 | Dicyclohexyl(4-dimethylaminophenyl)phosphine | C20H32NP |
| 40817-03-6 | [1,4-Phenylenebis(methylene)]bis[triphenylphosphonium] dibromide | C44H38Br2P2 |
| 4090-55-5 | 2-Chloro-5,5-Dimethyl-1,3,2-Dioxaphosphorinan-2-One | C5H10ClO3P |
| 4090-60-2 | 5,5-Dimethyl-1,3,2-Dioxaphosphorinan-2-One | C5H10O3P |
| 4125-25-1 | Triisobutylphosphine | C12H27P |
| 4141-48-4 | Allyldiphenylphosphine Oxide | C15H15OP |
| 41593-58-2 | (Diphenylphosphine)borane | C12H11P.BH3 |
| 4168-73-4 | Trihexylphosphine | C18H39P |
| 4202-14-6 | Dimethyl acetylmethylphosphonate | C5H11O4P |
| 4265-07-0 | Phospho(enol)pyruvic acid monopotassium salt | C3H4KO6P |
| 4271-13-0 | Methylphenylphosphinic Acid | C7H9O2P |
| 4297-95-4 | Sodium phenylphosphinate | C6H6NaO2P |
| 434336-16-0 | Bis[2-(dicyclohexylphosphino)phenyl] ether | C36H52OP2 |
| 436865-11-1 | Cyclohexyl di-tert-butylphosphine | C14H29P |
| 4378-40-9 | 2-Phosphonobutyric Acid | C4H6O5P |
| 4408-78-0 | Phosphonoacetic acid | C2H5O5P |
| 4441-12-7 | Trimorpholinophosphine oxide | C12H24N3O4P |
| 4559-70-0 | Diphenylphosphine oxide | C12H11OP |
| 46392-44-3 | Ethyldicyclohexylphosphine | C14H27P |
| 4645-32-3 | Dimethyl Vinylphosphonate | C4H9O3P |
| 4672-38-2 | Propylphosphonic acid | C3H9O3P |
| 4706-17-6 | Tris(Hydroxypropyl)Phosphine | C9H21O3P |
| 4707-95-3 | tert-Butylphosphonic dichloride | C4H9Cl2OP |
| 4708-04-7 | Propylphosphonic Dichloride | C3H7Cl2OP |
| 4721-24-8 | n-Hexylphosphonic acid | C6H15O3P |
| 4724-48-5 | 1-Octylphosphonic acid | C8H19O3P |
| 4731-53-7 | Trioctylphosphine | C24H51P |
| 4731-65-1 | Tris(2-methoxyphenyl)phosphine | C21H21O3P |
| 4762-26-9 | n-Hexyltriphenylphosphonium bromide | C24H28P.Br |
| 479094-62-7 | Bis(1,1-dimethylethyl)(methyl)phosphine tetrafluoroborate | C9H21P.BF4.H |
| 4848-43-5 | 2-(Diphenylphosphino)ethylamine | C14H16NP |
| 4923-84-6 | Tert-Butylphosphonic Acid | C4H9O3P |
| 49676-42-8 | Tris(2,4-dimethylphenyl)phosphine | C24H27P |
| 49721-50-8 | Spermidine Phosphate | C14H47N6O12P3 |
| 5044-52-0 | Triphenylvinylphosphonium bromide | C20H18P.Br |
| 50777-76-9 | 2-Diphenylphosphinobenzaldehyde | C19H15OP |
| 50917-73-2 | Diethyl N-Benzylideneaminomethylphosphonate | C12H18NO3P |
| 5112-95-8 | Bis(diphenylphosphino)acetylene | C26H20P2 |
| 5116-94-9 | Monotridecyl phosphate | C13H29O4P |
| 51567-05-6 | Tert-Butyldiisopropylphosphine | C10H23P |
| 51766-21-3 | Phenyl N-phenylphosphoramidochloridate | C12H11ClNO2P |
| 51805-45-9 | Tris(2-carboxyethyl)phosphine hydrochloride | C9H15O6P.HCl |
| 53111-20-9 | (2-Methoxyphenyl)diphenylphosphine | C19H17OP |
| 5324-30-1 | Diethyl bromoethylphosphonate | C6H14BrO3P |
| 53473-28-2 | Hexapotassium dihydrogen [hexane-1,6-diylbis[nitrilobis(methylene)]]tetrakisphosphonate | C10H22K6N2O12P4 |
| 53575-08-9 | Diethyl 1-Naphthylmethylphosphonate | C15H19O3P |
| 5381-99-7 | 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one | C7H4ClO3P |
| 53823-68-0 | Monosodium phosphoenolpyruvate | C3H4O6PNa |
| 53823-70-4 | Fructose-1-Phosphate Barium Salt | C6H11BaO9P |
| 5409-37-0 | Coriphosphine O | C16H18ClN3 |
| 5424-27-1 | 4-Aminobenzylphosphonic Acid | C7H10NO3P |
| 54300-32-2 | Bis(4-fluorophenyl)phenylphosphine oxide | C18H13F2OP |
| 54731-72-5 | Dimethyl 2-hydroxyethylphosphonate | C4H11O4P |
| 54965-29-6 | Ethyl 6-(Diethoxyphosphoryl)Hexanoate | C12H25O5P |
| 55-38-9 | Fenthion | C10H15O3PS2 |
| 5518-52-5 | Tri(2-furyl)phosphine | C12H9O3P |
| 5518-62-7 | 1,2-Bis(Phosphino)Ethane | C2H8P2 |
| 5525-40-6 | (4-Bromophenyl)diphenylphosphine oxide | C18H14BrOP |
| 5525-95-1 | Diphenyl(Pentafluorophenyl)Phosphine | C18H10F5P |
| 554-70-1 | Triethylphosphine | C6H15P |
| 55650-58-3 | (S)-(+)-N,N-Dimethyl-1-[(2-diphenylphosphino)ferrocenyl]ethylamine | C26H28FeNP |
| 55700-44-2 | (R)-(-)-N,N-Dimethyl-1-[(S)-2-(diphenylphosphino)ferrocenyl]ethylamine | C26H28FeNP |
| 56-04-2 | Methylthiouracil | C5H6N2OS |
| 56183-63-2 | Bis(diisopropylamino)chlorophosphine | C12H28ClN2P |
| 564483-19-8 | 2-Di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl | C29H45P |
| 565184-32-9 | (R)-(+)-1-[(R)-2-(2'-Diphenylphosphinophenyl)ferrocenyl]ethyldiphenylphosphine | C42H46FeP2 |
| 565184-34-1 | (1S)-1-[(1R)-1-[bis[3,5-bis(trifluoromethyl)phenyl]phosphino]ethyl]-2-[2-[bis(4-methoxy-3,5-dimethylphenyl)phosphino]phenyl]ferrocene | C52H44F12FeO2P2 |
| 566190-45-2 | 4-Diphenylphosphanylbenzoic acid 2-(trimethylsilyl)ethyl ester | |
| 5662-75-9 | 6-Phosphonohexanoic Acid | C6H13O5P |
| 5717-37-3 | Ethyl 2-(triphenylphosphoranylidene)propionate | C23H23O2P |
| 57283-72-4 | Methyl(triphenyl)phosphonium chloride | C19H18ClP |
| 57443-18-2 | Benzyl dimethyl phosphonoacetate | C11H15O5P |
| 5761-97-7 | Methylphenylphosphinic chloride | C7H8ClOP |
| 57775-19-6 | Calcium 1-Naphthyl Phosphate | C20H23CaO11P2+ |
| 5823-12-1 | Triethyl 2,2-Dichloro-2-Phosphonoacetate | C8H15Cl2O5P |
| 5849-36-5 | Diphenylphosphinic Anhydride | C24H20O3P2 |
| 58656-04-5 | Tricyclohexylphosphonium tetrafluoroborate | C18H34BF4P |
| 5871-17-0 | Potassium O,O-diethyl phosphorothioate | C4H10O3PS.K |
| 589-57-1 | Diethyl chlorophosphite | C4H10ClO2P |
| 5927-18-4 | Trimethyl phosphonoacetate | C5H11O5P |
| 5931-53-3 | (2-Methylphenyl)diphenylphosphine | C19H17P |
| 594-09-2 | Trimethylphosphine | C3H9P |
| 5962-41-4 | 2-Phosphonopropionic Acid | C3H7O5P |
| 5962-42-5 | 3-Phosphonopropionic acid | C3H7O5P |
| 597-50-2 | Triethylphosphine oxide | C6H15OP |
| 5994-61-6 | N-(Carboxymethyl)-N-(phosphonomethyl)-glycine | C5H10NO7P |
| 6002-31-9 | Tert-Butylphenylphosphine | C10H15P |
| 6002-34-2 | tert-Butyldiphenylphosphine | C16H19P |
| 6002-40-0 | Bis(tert-butyl)methylphosphine | C9H21P |
| 60565-88-0 | Bis(4-methylphenyl)iodonium hexafluorophosphate | C14H14I.F6P |
| 60648-70-6 | Bis(tri-tert-butylphosphine)platinum | C24H54P2Pt |
| 607-01-2 | Diphenylethylphosphine | C14H15P |
| 610756-04-2 | Tricyclopentylphosphonium tetrafluoroborate | C15H28BF4P |
| 612088-55-8 | Bis(1,1-dimethylethyl)(phenyl)Phosphine tetrafluoroborate | C14H23P.BF4.H |
| 61358-25-6 | Bis(4-tert-butylphenyl)iodonium hexafluorophosphate | C20H26F6IP |
| 6145-31-9 | 1,2-Ethylenediphosphonic Acid | C2H8O6P2 |
| 61451-78-3 | Hydroxymethylphenylphosphinic acid | C7H9O3P |
| 6163-58-2 | Tris(2-methylphenyl)phosphine | C21H21P |
| 6163-75-3 | Dimethyl Ethylphosphonate | C4H11O3P |
| 6224-63-1 | Tris(3-methylphenyl)phosphine | C21H21P |
| 62327-21-3 | tert-Butyl O,O-dimethylphosphonoacetate | C8H17O5P |
| 627-49-6 | Diethylphosphine | C4H11P |
| 628333-86-8 | 1-[2-[Bis(1,1-dimethylethyl)phosphino]phenyl]-3,5-diphenyl-1H-pyrazole | C29H33N2P |
| 63132-39-8 | Olpadronic acid | C5H15NO7P2 |
| 6323-97-3 | DL-1-(Aminoethyl)phosphonic acid | C2H8NO3P |
| 6372-40-3 | Isopropyldiphenylphosphine | C15H17P |
| 6372-42-5 | Cyclohexyldiphenylphosphine | C18H21P |
| 638-21-1 | Phenyl phosphine | C6H7P |
| 63909-58-0 | Diethyl (4-fluorobenzyl)phosphonate | C11H16FO3P |
| 6396-07-2 | Diiodotriphenylphosphorane | C18H15I2P |
| 6399-81-1 | Triphenylphosphine hydrobromide | C18H15P.HBr |
| 63995-70-0 | Triphenylphosphine-3,3',3''-trisulfonic acid trisodium salt | C18H12Na3O9PS3 |
| 63995-75-5 | 3-(Diphenylphosphino)-Benzenesulfonic Acid Sodium Salt (1:1) | C18H14NaO3PS |
| 64065-08-3 | Bis(dimethylphosphino)methane | C5H14P2 |
| 6415-07-2 | Tris(pyrrolidinophosphine) oxide | C12H24N3OP |
| 6419-19-8 | Amino tris(methylene phosphonic acid) | C3H12NO9P3 |
| 644-97-3 | Dichlorophenylphosphine | C6H5Cl2P |
| 64741-27-1 | 2,6-Bis(diphenylphosphino)pyridine | C29H23NP2 |
| 6476-36-4 | Triisopropylphosphine | C9H21P |
| 6476-37-5 | Dicyclohexylphenylphosphine | C18H27P |
| 65038-36-0 | 1,4-Bis(dicyclohexylphosphino)butane | C28H52P2 |
| 65094-22-6 | Diethyl bromodifluoromethanephosphonate | C5H10BrF2O3P |
| 65300-05-2 | Dibenzyltrisulfide | C14H14S3 |
| 65423-44-1 | 2-(Diphenylphosphino)phenylamine | C18H16NP |
| 65567-06-8 | LithiuM diphenylphosphide | |
| 657408-07-6 | 2-Dicyclohexylphosphino-2',6'-dimethoxybiphenyl | C26H35O2P |
| 66254-55-5 | [(1S)-1-Amino-2-Methylpropyl]-Phosphonic Acid | |
| 66254-56-6 | [(1R)-1-Amino-2-Methylpropyl]-Phosphonic Acid | C4H12NO3P |
| 66470-81-3 | Tris(1,1,1,3,3,3-Hexafluoro-2-Propyl) Phosphite | C9H3F18O3P |
| 672-66-2 | Dimethylphenylphosphine | C8H11P |
| 6737-42-4 | 1,3-Bis(diphenylphosphino)propane | C27H26P2 |
| 676-83-5 | Methyldichlorophosphine | CH3Cl2P |
| 676-96-0 | Trimethylphosphine oxide | C3H9OP |
| 676-97-1 | Methylphosphonic dichloride | CH3Cl2OP |
| 676-98-2 | Methylphosphonothioyl dichloride | CH3Cl2PS |
| 677-43-0 | N,N-Dimethylaminophosphoryl dichloride | C2H6Cl2NOP |
| 67746-43-4 | Dibenzyl N,N-diethylphosphoramidite | C18H24NO2P |
| 6779-09-5 | Ethylphosphonic acid | C2H7O3P |
| 67881-98-5 | 2-Methacryloyloxyethyl phosphorylcholine | C11H22NO6P |
| 67953-76-8 | 1-Hydroxyethanediphosphonic acid potassium salt | C2H8O7P2.xK |
| 68014-21-1 | N-Boc-imino(triphenyl)phosphorane | C23H24NO2P |
| 68089-86-1 | (Chloromethyl)triphenylphosphonium iodide | C19H17ClP.I |
| 682-30-4 | Diethyl Vinylphosphonate | C6H13O3P |
| 683-08-9 | Diethyl methylphosphonate | C5H13O3P |
| 683-85-2 | Dimethylphosphoramidous Dichloride | C2H6Cl2NP |
| 685-83-6 | Bis(diethylamino)chlorophosphine | C8H20ClN2P |
| 686-69-1 | Chlorodiethylphosphine | C4H10ClP |
| 69227-47-0 | Tris(3,5-dimethylphenyl)phosphine | C24H27P |
| 69320-80-5 | Phenyl-Phosphoramidochloridicacid 2-Chlorophenyl Ester | C12H10Cl2NO2P |
| 6996-81-2 | O,O'-Diethyl Methylphosphonothioate | C5H13O2PS |
| 7023-27-0 | Methyl dihydrogen phosphate - cyclohexanamine (1:2) | C13H31N2O4P |
| 707-61-9 | 4,5-Dihydro-3-methyl-1-phenyl-1H-phosphole 1-oxide | C11H13OP |
| 71050-62-9 | Poly (acrylic acid-co-hypophosphite) sodium salt | |
| 71501-08-1 | Di-n-Pentylphenylphosphine | C16H27P |
| 719-80-2 | Ethyl diphenylphosphinite | C14H15OP |
| 7211-39-4 | Dimethylphosphine oxide | C2H7OP |
| 7215-33-0 | Ethyl(dimethyl)phosphine oxide | C4H11OP |
| 72287-26-4 | [1,1'-Bis(diphenylphosphino)ferrocene]dichloropalladium(II) | C34H28Cl2FeP2Pd |
| 72461-86-0 | Carbamic Acid Monoanhydride With Phosphoric Acid Disodium Salt | CH2NNa2O5P |
| 72578-71-3 | 3-(2-Chloroacetyl)-2-[(2-chloroethyl)amino]tetrahydro-2H-1,3,2-oxazaphosphorine-2-oxide | C7H13N2PO3Cl2 |
| 72804-96-7 | (Aminooxy)diphenylphosphine oxide | C12H12NO2P |
| 7310-74-9 | Cinnamyltriphenylphosphonium Bromide | C27H24BrP |
| 7333-51-9 | Cyclohexyltriphenylphosphonium Bromide | C24H26BrP |
| 7333-52-0 | Cyclopentyltriphenyl-Phosphonium Bromide (1:1) | C23H24BrP |
| 73789-56-7 | (Isocyanoimino)Triphenylphosphorane | C19H15N2P |
| 739-58-2 | 4-(Dimethylamino)phenyldiphenylphosphine | C20H20NP |
| 74289-57-9 | Bis(3,5-dimethylphenyl)chlorophosphine | C16H18ClP |
| 74839-84-2 | (2R,3R)-(+)-2,3-Bis(diphenylphosphino)butane | C28H28P2 |
| 75482-18-7 | Diphenyl[(phenylthio)phenyl]sulfonium hexafluorophosphate | C24H19S2.F6P |
| 756-79-6 | Dimethyl methylphosphonate | C3H9O3P |
| 76-98-2 | Conopharyngine | C23H30N2O4 |
| 7650-88-6 | Tricyclopentylphosphine | C15H27P |
| 7650-89-7 | Tribenzylphosphine | C21H21P |
| 7650-91-1 | Benzyldiphenylphosphine | C19H17P |
| 7651-99-2 | Ethylenediamine tetra(methylenephosphonic acid) pentasodium salt | C6H15N2Na5O12P4 |
| 76527-75-8 | N-[(Diphenylphosphinyl)Methyl]-N-Methylaniline | C20H20NOP |
| 76858-94-1 | 1,2-Bis(dipentafluorophenylphosphino)ethane | C26H4F20P2 |
| 7688-25-7 | 1,4-Bis(diphenylphosphino)butane | C28H28P2 |
| 77-76-9 | 2,2-Dimethoxypropane | C5H12O2 |
| 77182-82-2 | Glufosinate-ammonium | C5H15N2O4P |
| 772-79-2 | 4-Chlorophenyl dichlorophosphinate | C6H4Cl3O2P |
| 773-47-7 | Dimethyl benzylphosphonate | C9H13O3P |
| 77350-04-0 | Chlorophosphonazo Mn | C22H15ClN5O13PS2 |
| 777-52-6 | 4-Nitrophenyl phosphoryldichloride | C6H4Cl2NO4P |
| 78-50-2 | Trioctylphosphine oxide | C24H51OP |
| 791-28-6 | Triphenylphosphine oxide | C18H15OP |
| 797-70-6 | Tris(4-Methylphenyl)Phosphine Oxide | C21H21OP |
| 79778-41-9 | Neridronate Sodium Hydrate | C6H17NO7P2 |
| 80510-04-9 | 1,2-Bis(Phosphino)Benzene | C6H8P2 |
| 81-88-9 | Rhodamine B | C28H31N2O3.Cl |
| 81012-89-7 | 1-Naphthyl phosphate monosodium salt monohydrate | C10H8NaO4P.H2O |
| 811-62-1 | Dimethylchlorophosphine | C2H6ClP |
| 811862-77-8 | Bis(3,5,3',5'-dimethoxydibenzylideneacetone)palladium | C42H44O10Pd |
| 814-29-9 | Tributylphosphine oxide | C12H27OP |
| 819-19-2 | Di-tert-butylphosphine | C8H19P |
| 822-39-9 | 2-Chloro-1,3,2-dioxaphospholane | C2H4ClO2P |
| 82395-88-8 | Anilinium Hypophosphite | C6H10NO2P |
| 824-11-3 | Trimethylolpropane Phosphite | C6H11O3P |
| 824-72-6 | Phenylphosphonic dichloride | C6H5Cl2OP |
| 829-84-5 | Dicyclohexylphosphine | C12H23P |
| 829-85-6 | Diphenylphosphine | C12H11P |
| 83-08-9 | 2-(2-Quinolyl)-1H-Indene-1,3(2H)-Dione | C18H11NO2 |
| 83411-71-6 | Bis(2,4,4-trimethylpentyl)phosphinic acid | C16H35O2P |
| 84127-04-8 | Bis(4-Methoxyphenyl)phosphine | |
| 84176-65-8 | 6,7-Bis(1-methylethyl)-2,4-pteridinediamine phosphate (1:1) | C12H18N6.H3PO4 |
| 84494-89-3 | 1,1-Ethenediylbis(diphenylphosphine) | C26H22P2 |
| 84680-95-5 | 1,1'-Bis(di-tert-butylphosphino)ferrocene | C26H44FeP2 |
| 84783-64-2 | 2,2'-Bis(diphenylphosphino)-1,1'-biphenyl | C36H28P2 |
| 85-83-6 | Solvent Red 24 | C24H20N4O |
| 85197-27-9 | Tris(Tert-Butyldimethylsilyl) Phosphite | C18H45O3PSi3 |
| 853073-44-6 | Di-Tert-Butylmethylphosphonium Tetraphenylborate | C33H41BP |
| 85417-41-0 | Tris(2,6-Dimethoxyphenyl)Phosphine | C24H27O6P |
| 855-38-9 | Tris(4-methoxyphenyl)phosphine | C21H21O3P |
| 85685-99-0 | 1,3-Bis(diphenylphosphino)propane oxide | C27H26OP2 |
| 86030-43-5 | N-[chloro(methoxy)phosphanyl]-N-propan-2-ylpropan-2-amine | C7H17ClNOP |
| 86167-87-5 | 3-[(3-acetylphenyl)azo]-6-[(4-chloro-2- phosphonophenyl)azo]-4,5-dihydroxy-2,7-Naphthalenedisulfonic acid | C24H18ClN4O12PS2 |
| 866-23-9 | Diethyl Trichloromethylphosphonate | C5H10Cl3O3P |
| 870703-48-3 | Dicyclohexyl(2,4,6-trimethylphenyl)phosphine | C21H33P |
| 870777-30-3 | Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate | C9H22BF4P |
| 89-86-1 | 2,4-Dihydroxybenzoic acid | C7H6O4 |
| 89992-70-1 | 2-Cyanoethyl N,N-diisopropylchlorophosphoramidite | C9H18ClN2OP |
| 904894-54-8 | Zoledronic Acid Trihydrate | C5H16N2O10P2 |
| 91608-15-0 | Tris(2,4,6-trimethoxyphenyl)phosphine | C27H33O9P |
| 91987-74-5 | 1,4,7,10-Tetraazacyclododecane-1,4,7,10-tetrakis(methylphosphonic acid) | C12H32N4O12P4 |
| 921-26-6 | Diisopropylphosphoramidous dichloride | C6H14Cl2NP |
| 92466-70-1 | Bis(2,2,2-Trifluoroethyl) Phosphite | C4H4F6O3P |
| 92611-10-4 | Methyl tetraisopropylphosphorodiamidite | C13H31N2OP |
| 93634-87-8 | tert-Butyldicyclohexylphosphine | C16H31P |
| 940934-47-4 | 4,5-Bis(dicyclohexylphosphino)-9,9-dimethyl-9H-xanthene | C39H56OP2 |
| 98048-99-8 | [(1S)-1-Aminopropyl]phosphonic acid | C3H10NO3P |
| 98049-00-4 | P-[(1R)-1-Aminopropyl]-Phosphonic Acid | |
| 983-80-2 | cis-1,2-Bis(diphenylphosphine)ethene | C26H22P2 |
| 983-81-3 | trans-1,2-Bis(diphenylphosphino)ethylene | C26H22P2 |
| 98327-87-8 | (+/-)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl | C44H32P2 |
| 984-43-0 | 1,2-Bis(diphenylphosphino)ethane monooxide | C26H24OP2 |
| 993-13-5 | Methylphosphonic acid | CH5O3P |
| 99665-68-6 | Bis(4-Trifluoromethylphenyl)Phosphine | C14H9F6P |
| 998-40-3 | Tributylphosphane | C12H27P |