Online Database of Chemicals from Around the World
| Product Name | CAS Registry Number | Molecular Formula |
|---|---|---|
| Nitric acid, rare earth salts | 68412-17-9 | |
| Nitric acid-sulfuric acid mixture | 51602-38-1 | |
| Nitridotrisulfuric acid tripotassium salt | 63504-30-3 | K3NO9S3 |
| Nitrilotriacetic acid | 139-13-9 | C6H9NO6 |
| Nitrilotriacetic acid trisodium salt monohydrate | 18662-53-8 | C6H6NO6.3Na.H2O |
| 2,2',2''-Nitrilotriacetonitrile | 7327-60-8 | C6H6N4 |
| 2,2',2''-Nitrilotriethanol o-nitrobenzoate | 71720-51-9 | C7H5NO4.C6H15NO3 |
| 2,2',2''-Nitrilotriethanol p-nitrobenzoate | 7394-38-9 | C7H5NO4.C6H15NO3 |
| 2,2',2''-Nitrilotris[N-(2,6-dimethylphenyl)acetamide] | 1374010-02-2 | C30H36N4O3 |
| 2,2',2''-Nitrilotris[ethanol] compd. with alpha-[2,4,6-tris(1-phenylethyl)phenyl]-omega-hydroxypoly(oxy-1,2-ethanediyl) phosphate | 105362-40-1 | C38H52NO9P |
| 2,2',2''-Nitrilotris[ethanol] 2-ethylhexyl phosphate (salt) | 68189-01-5 | C8H18O.x(C6H15NO3).x(H3PO4) |
| 2,2',2''-Nitrilotrisethanol 12-hydroxyoctadecanoate (salt) | 93893-45-9 | C18H36O3.C6H15NO3 |
| 2,2',2''-Nitrilotrisethanol 6-[[(4-methylphenyl)sulfonyl]amino]hexanoate (salt) | 93981-14-7 | C13H19NO4S.C6H15NO3 |
| 2,2',2''-Nitrilotris-Ethanol nonanedioate (2:1) (salt) | 85030-05-3 | C9H16O4.2(C6H15NO3) |
| 2,2',2''-Nitrilotrisethanol octanedioate (2:1) (salt) | 85030-04-2 | C8H14O4.2(C6H15NO3) |
| [Nitrilotris(methylene)]tris-phosphonic acid pentasodium salt | 2235-43-0 | C3H7NNa5O9P3 |
| 4,4',4''-[Nitrilotris(methylene)]tris-1H-1,2,3-triazole-1-acetic acid triethyl ester | 736958-00-2 | C21H30N10O6 |
| 1,1',1''-Nitrilotris-2-propanol compd. with 2-[4-[[1-[[(2-methoxy-5-sulfophenyl)amino]carbonyl]-2-oxopropyl]azo]phenyl]-6-methyl-7-benzothiazolesulfonic acid sodium salt | 85392-18-3 | C25H22N4O9S3.C9H21NO3.x(Na) |
| 5-Nitroacenaphthene | 602-87-9 | C12H9NO2 |
| Nitroacetaldehyde diethyl acetal | 34560-16-2 | C6H13NO4 |
| Nitroacetaldehyde dimethyl acetal | 69425-53-2 | C4H9NO4 |
| 4'-Nitroacetanilide | 104-04-1 | C8H8N2O3 |
| 3'-Nitroacetanilide | 122-28-1 | C8H8N2O3 |
| Nitroacetonitrile | 13218-13-8 | C2H2N2O2 |
| 4'-Nitroacetophenone | 100-19-6 | C8H7NO3 |
| 3'-Nitroacetophenone | 121-89-1 | C8H7NO3 |
| 2'-Nitroacetophenone | 577-59-3 | C8H7NO3 |
| 2-Nitroacetophenone | 614-21-1 | C8H7NO3 |
| 1-Nitroadamantane | 7575-82-8 | C10H15NO2 |
| 4-Nitro-1-aminoanthraquinone-2-carboxylic acid | 2058-02-8 | C15H8N2O6 |
| 2-Nitro-4-aminodiphenylamine | 2784-89-6 | C12H11N3O2 |
| 2-Nitroaminoimidazoline | 5465-96-3 | C3H6N4O2 |
| 4-Nitro-4'-aminostilbene-2,2'-disulfonic acid | 119-72-2 | C14H12N2O8S2 |
| 2-Nitro-3-aminothiophene | 52003-20-0 | C4H4N2O2S |
| 4-Nitroaniline | 100-01-6 | C6H6N2O2 |
| 2-Nitroaniline | 88-74-4 | C6H6N2O2 |
| 3-Nitroaniline | 99-09-2 | C6H6N2O2 |
| 2-Nitroaniline-4-sulfonic acid | 616-84-2 | C6H6N2O5S |
| 4-(2-Nitroanilino)pyridine | 25551-59-1 | C11H9N3O2 |
| 4-Nitroanisole | 100-17-4 | C7H7NO3 |
| 3-Nitroanisole | 555-03-3 | C7H7NO3 |
| 2-Nitroanisole | 91-23-6 | C7H7NO3 |
| 10-Nitroanthracene-1,2,3,4,5,6,7,8,9-d9 | 220381-38-4 | C14D9NO2 |
| 9-Nitroanthracene | 602-60-8 | C14H9NO2 |
| 4-Nitroanthranilic acid | 619-17-0 | C7H6N2O4 |
| 5-Nitroanthranilonitrile | 17420-30-3 | C7H5N3O2 |
| 1-Nitroanthraquinone-5-sulfonic acid sodium salt | 82-50-8 | C14H6NNaO7S |
| N'-Nitro-L-arginine | 2149-70-4 | C6H13N5O4 |
| N-Boc-N'-nitro-L-arginine | 2188-18-3 | C11H21N5O6 |
| Cbz-N'-nitro-L-arginine | 2304-98-5 | C14H19N5O6 |