| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Leap Chem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2022 | ||||
| Classification | Biochemical >> Common amino acids and protein drugs |
|---|---|
| Name | Vadadustat |
| Synonyms | AKB-6548; AKB 6548; AKB6548; PG-1016548 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11ClN2O4 |
| Molecular Weight | 306.70 |
| CAS Registry Number | 1000025-07-9 |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC(=C(N=C2)C(=O)NCC(=O)O)O |
| InChI | 1S/C14H11ClN2O4/c15-10-3-1-2-8(4-10)9-5-11(18)13(16-6-9)14(21)17-7-12(19)20/h1-6,18H,7H2,(H,17,21)(H,19,20) |
| InChIKey | JGRXMPYUTJLTKT-UHFFFAOYSA-N |
| Melting point | 172-174°C (Expl.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Vadadustat |