Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Tricyclo[5.4.0.04,8]Undecane-1-Carbonyl Chloride |
|---|---|
| Synonyms | octahydro-1H-1,4-ethanoindene-4-carbonyl chloride |
| Molecular Structure | ![CAS#: 100020-95-9， Tricyclo[5.4.0.0<Sup>4,8</Sup>]Undecane-1-Carbonyl Chloride](/moreStructures/100020-95-9.gif) |
| Molecular Formula | C12H17ClO |
| Molecular Weight | 212.72 |
| CAS Registry Number | 100020-95-9 |
| SMILES | C1CC2C3CCC2C(C1)(CC3)C(=O)Cl |
| InChI | 1S/C12H17ClO/c13-11(14)12-6-1-2-9-8(5-7-12)3-4-10(9)12/h8-10H,1-7H2 |
| InChIKey | JFDNLCLFCJWMAD-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.054°C at 760 mmHg (Cal.) |
| Flash point | 153.974°C (Cal.) |
| Refractive index | 1.543 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tricyclo[5.4.0.04,8]Undecane-1-Carbonyl Chloride |