Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 5-Chloro-7-[(Dimethylamino)Methyl]-8-Quinolinol |
|---|---|
| Synonyms | 5-Chlor-7-[(dimethylamino)methyl]-8-chinolinol; 5-Chloro-7-[(diméthylamino)méthyl]-8-quinoléinol; 5-Chloro-7-[(dimethylamino)methyl]-8-quinolinol |
| Molecular Structure | ![CAS#: 100119-17-3， 5-Chloro-7-[(Dimethylamino)Methyl]-8-Quinolinol](/moreStructures/100119-17-3.gif) |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 |
| CAS Registry Number | 100119-17-3 |
| SMILES | CN(C)Cc1cc(c2cccnc2c1O)Cl |
| InChI | 1S/C12H13ClN2O/c1-15(2)7-8-6-10(13)9-4-3-5-14-11(9)12(8)16/h3-6,16H,7H2,1-2H3 |
| InChIKey | XDBJPIMUEMEJLT-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.4±37.0°C at 760 mmHg (Cal.) |
| Flash point | 174.2±26.5°C (Cal.) |
| Refractive index | 1.648 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-7-[(Dimethylamino)Methyl]-8-Quinolinol |