Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,4,4-Trimethyl-2-Cyclohexene-1-Carbonyl Chloride |
|---|---|
| Synonyms | 1,4,4-Trimethyl-2-cyclohexene-1-carbonyl chloride #; 1,4,4-trimethylcyclohex-2-enecarbonyl chloride; 2-Cyclohexene-1-carbonyl chloride, 1,4,4-trimethyl- |
| Molecular Structure |  |
| Molecular Formula | C10H15ClO |
| Molecular Weight | 186.68 |
| CAS Registry Number | 100131-18-8 |
| SMILES | ClC(=O)C1(/C=C\C(C)(C)CC1)C |
| InChI | 1S/C10H15ClO/c1-9(2)4-6-10(3,7-5-9)8(11)12/h4,6H,5,7H2,1-3H3 |
| InChIKey | VHKATWXQNBOEAJ-UHFFFAOYSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 207.757°C at 760 mmHg (Cal.) |
| Flash point | 102.283°C (Cal.) |
| Refractive index | 1.466 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4,4-Trimethyl-2-Cyclohexene-1-Carbonyl Chloride |