Online Database of Chemicals from Around the World
|
CAS#: 100217-09-2 Product: O(6)-(2-Chloroethyl)Guanine No suppilers available for the product. |
| Name | O(6)-(2-Chloroethyl)Guanine |
|---|---|
| Synonyms | [6-(2-Chloroethoxy)-7H-Purin-2-Yl]Amine; O(6)-(2-Chloroethyl)Guanine; O(6)-2-Ceg |
| Molecular Structure |  |
| Molecular Formula | C7H8ClN5O |
| Molecular Weight | 213.63 |
| CAS Registry Number | 100217-09-2 |
| SMILES | C2=NC1=NC(=NC(=C1[NH]2)OCCCl)N |
| InChI | 1S/C7H8ClN5O/c8-1-2-14-6-4-5(11-3-10-4)12-7(9)13-6/h3H,1-2H2,(H3,9,10,11,12,13) |
| InChIKey | VGKZFRLEZKOTCQ-UHFFFAOYSA-N |
| Density | 1.574g/cm3 (Cal.) |
|---|---|
| Boiling point | 617.224°C at 760 mmHg (Cal.) |
| Flash point | 327.085°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O(6)-(2-Chloroethyl)Guanine |