Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Methyl-5-Nitrobenzoyl Chloride |
|---|---|
| Synonyms | 3-methyl-5-nitrobenzoyl chloride |
| Molecular Structure |  |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59 |
| CAS Registry Number | 100249-20-5 |
| SMILES | O=N(=O)c1cc(cc(C)c1)C(Cl)=O |
| InChI | 1S/C8H6ClNO3/c1-5-2-6(8(9)11)4-7(3-5)10(12)13/h2-4H,1H3 |
| InChIKey | RXKPUZLHKIIVSS-UHFFFAOYSA-N |
| Density | 1.386g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.365°C at 760 mmHg (Cal.) |
| Flash point | 142.713°C (Cal.) |
| Refractive index | 1.579 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-5-Nitrobenzoyl Chloride |