| Proactive Molecular Research | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.proactivemr.com | |||
![]() | +1 (352) 505-2681 | |||
![]() | +1 (352) 331-7478 | |||
![]() | tony@proactivemr.com | |||
| Chemical manufacturer | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Carboxylic acid |
|---|---|
| Name | (3S,4R)-1-(tert-Butoxycarbonyl)-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid |
| Synonyms | Boc-(3S,4R)-beta-Pro-4-(4-fluorophenyl)-OH |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 309.33 |
| CAS Registry Number | 1002732-10-6 |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)C(=O)O)C2=CC=C(C=C2)F |
| Solubility | 22.09 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.537, Calc.* |
| Melting point | 159.84 °C |
| Boiling Point | 439.9±45.0 °C (760 mmHg), Calc.*, 399.58 °C |
| Flash Point | 219.9±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for (3S,4R)-1-(tert-Butoxycarbonyl)-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid |