| Jinan Wonder Pharmtech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.wonderpharmtech.com | |||
![]() | +86 18601195352 | |||
![]() | wonderpharmtech@gmail.com | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 1-Isopropyl-3-nitro-1H-pyrazole |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.15 |
| CAS Registry Number | 1003012-75-6 |
| SMILES | CC(C)N1C=CC(=N1)[N+](=O)[O-] |
| Solubility | 2135 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.582, Calc.* |
| Melting point | 64.43 °C |
| Boiling Point | 245.25 °C, 248.8±13.0 °C (760 mmHg), Calc.* |
| Flash Point | 104.3±19.8 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319 Details |
| Safety Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1-Isopropyl-3-nitro-1H-pyrazole |