|
CAS#: 10037-19-1 Product: 3-Acetyl-2-Methyl-6-Phenyl-4(1H)-Pyridinone No suppilers available for the product. |
| Name | 3-Acetyl-2-Methyl-6-Phenyl-4(1H)-Pyridinone |
|---|---|
| Synonyms | 3-Acetyl-2-methyl-6-phenyl-4(1H)-pyridinone; 3-Acetyl-2-methyl-6-phenyl-4(1H)-pyridinone #; 4(1H)-Pyridone, 3-acetyl-2-methyl-6-phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 10037-19-1 |
| SMILES | O=C(C=2C(=O)/C=C(/c1ccccc1)NC=2C)C |
| InChI | 1S/C14H13NO2/c1-9-14(10(2)16)13(17)8-12(15-9)11-6-4-3-5-7-11/h3-8H,1-2H3,(H,15,17) |
| InChIKey | SOQQITSEIPSBCO-UHFFFAOYSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.038°C at 760 mmHg (Cal.) |
| Flash point | 172.705°C (Cal.) |
| Refractive index | 1.571 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Acetyl-2-Methyl-6-Phenyl-4(1H)-Pyridinone |