| Classification | Biochemical >> Amino acids and their derivatives >> Alanine derivatives |
|---|---|
| Name | (2S)-2-({[(2-Methyl-2-Propanyl)Oxy]Carbonyl}Amino)-3-(1-Pyrenyl)Propanoic Acid |
| Synonyms | BOC-3-(1-PYRENYL)-L-ALANINE |
| Molecular Structure | ![]() |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.44 |
| CAS Registry Number | 100442-89-5 |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=C2C=CC3=CC=CC4=C3C2=C(C=C4)C=C1)C(=O)O |
| InChI | 1S/C24H23NO4/c1-24(2,3)29-23(28)25-19(22(26)27)13-17-10-9-16-8-7-14-5-4-6-15-11-12-18(17)21(16)20(14)15/h4-12,19H,13H2,1-3H3,(H,25,28)(H,26,27)/t19-/m0/s1 |
| InChIKey | JDYATIJHVFTYFG-IBGZPJMESA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 614.8±48.0°C at 760 mmHg (Cal.) |
| Flash point | 325.6±29.6°C (Cal.) |
| Refractive index | 1.702 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-({[(2-Methyl-2-Propanyl)Oxy]Carbonyl}Amino)-3-(1-Pyrenyl)Propanoic Acid |