Online Database of Chemicals from Around the World
|
CAS#: 10045-38-2 Product: 5-Methyl-2-Nitro-Benzimidazole No suppilers available for the product. |
| Name | 5-Methyl-2-Nitro-Benzimidazole |
|---|---|
| Synonyms | 5-Methyl-2-Nitrobenzimidazole; Brn 0912103; Benzimidazole, 5-Methyl-2-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 |
| CAS Registry Number | 10045-38-2 |
| SMILES | C2=C1[NH]C(=NC1=CC=C2C)[N+]([O-])=O |
| InChI | 1S/C8H7N3O2/c1-5-2-3-6-7(4-5)10-8(9-6)11(12)13/h2-4H,1H3,(H,9,10) |
| InChIKey | ZHWBOFHMPVMAIO-UHFFFAOYSA-N |
| Density | 1.438g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.082°C at 760 mmHg (Cal.) |
| Flash point | 207.254°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2-Nitro-Benzimidazole |