Online Database of Chemicals from Around the World
| Name | 1-(2-Thienyl)-4,4,4-Trifluoro-3-Trifluoromethyl-2-Buten-1-Ol |
|---|---|
| Synonyms | 4,4,4-Trifluoro-1-(2-Thienyl)-3-(Trifluoromethyl)But-2-En-1-Ol; Alpha-(3,3,3-Trifluoro-2-Trifluoromethylpropenyl)-2-Thiophenemethanol; Nsc162138 |
| Molecular Structure |  |
| Molecular Formula | C9H6F6OS |
| Molecular Weight | 276.20 |
| CAS Registry Number | 100482-55-1 |
| SMILES | C1=C(SC=C1)C(O)C=C(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C9H6F6OS/c10-8(11,12)7(9(13,14)15)4-5(16)6-2-1-3-17-6/h1-5,16H |
| InChIKey | DTHGYDUZALFGDB-UHFFFAOYSA-N |
| Density | 1.487g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.668°C at 760 mmHg (Cal.) |
| Flash point | 116.891°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Thienyl)-4,4,4-Trifluoro-3-Trifluoromethyl-2-Buten-1-Ol |
