Online Database of Chemicals from Around the World
| Name | 6,8-Diiodo-4(1H)-Quinazolinone |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C8H4I2N2O |
| Molecular Weight | 397.94 |
| CAS Registry Number | 100540-61-2 |
| SMILES | Ic2cc(I)c1c(C(=O)\N=C/N1)c2 |
| InChI | 1S/C8H4I2N2O/c9-4-1-5-7(6(10)2-4)11-3-12-8(5)13/h1-3H,(H,11,12,13) |
| InChIKey | BKXIKKIMTDJQTM-UHFFFAOYSA-N |
| Density | 2.721g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.821°C at 760 mmHg (Cal.) |
| Flash point | 233.706°C (Cal.) |
| Refractive index | 1.873 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6,8-Diiodo-4(1H)-Quinazolinone |
