|
CAS#: 10061-22-0 Product: 1-Nitro-4-[1-(Nitrooxy)Ethyl]Benzene No suppilers available for the product. |
| Name | 1-Nitro-4-[1-(Nitrooxy)Ethyl]Benzene |
|---|---|
| Synonyms | Nitric Acid 1-(4-Nitrophenyl)Ethyl Ester; 1-(P-Nitrophenyl)Ethyl Nitrate; 1-P-Nitrofenylethylester Kyseliny Dusicne [Czech] |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.16 |
| CAS Registry Number | 10061-22-0 |
| SMILES | C1=C(C(O[N+]([O-])=O)C)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C8H8N2O5/c1-6(15-10(13)14)7-2-4-8(5-3-7)9(11)12/h2-6H,1H3 |
| InChIKey | QFPAMHKBIYSCKR-UHFFFAOYSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.579°C at 760 mmHg (Cal.) |
| Flash point | 164.26°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-4-[1-(Nitrooxy)Ethyl]Benzene |