|
CAS#: 10061-32-2 Product: Levophenacylmorphan No suppilers available for the product. |
| Name | Levophenacylmorphan |
|---|---|
| Synonyms | Levophenacylmorphanum [Inn-Latin]; (-)-3-Hydroxy-N-Phenacylmorphinan; Dea No. 9631 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.48 |
| CAS Registry Number | 10061-32-2 |
| EINECS | 233-198-4 |
| SMILES | [C@]235[C@H]([C@H](N(CC(C1=CC=CC=C1)=O)CC2)CC4=C3C=C(O)C=C4)CCCC5 |
| InChI | 1S/C24H27NO2/c26-19-10-9-18-14-22-20-8-4-5-11-24(20,21(18)15-19)12-13-25(22)16-23(27)17-6-2-1-3-7-17/h1-3,6-7,9-10,15,20,22,26H,4-5,8,11-14,16H2/t20-,22+,24+/m0/s1 |
| InChIKey | RCYBMSQOSGJZLO-BGWNEDDSSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.465°C at 760 mmHg (Cal.) |
| Flash point | 289.13°C (Cal.) |
| Controlled Substance | DEA Drug Code Number: 9631 Details |
|---|---|
| CSA Schedule: I | |
| Is Narcotics? Yes | |
| Market Analysis Reports |
| List of Reports Available for Levophenacylmorphan |