Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-[(3,5-Dichloro-4-Methoxyphenyl)Amino]Benzoic Acid |
|---|---|
| Synonyms | 2-((3,5-dichloro-4-methoxyphenyl)amino)benzoic acid |
| Molecular Structure | ![CAS#: 100623-27-6， 2-[(3,5-Dichloro-4-Methoxyphenyl)Amino]Benzoic Acid](/moreStructures/100623-27-6.gif) |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.15 |
| CAS Registry Number | 100623-27-6 |
| SMILES | Clc1cc(cc(Cl)c1OC)Nc2ccccc2C(=O)O |
| InChI | 1S/C14H11Cl2NO3/c1-20-13-10(15)6-8(7-11(13)16)17-12-5-3-2-4-9(12)14(18)19/h2-7,17H,1H3,(H,18,19) |
| InChIKey | UZTXFSDUGHCLPA-UHFFFAOYSA-N |
| Density | 1.446g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.149°C at 760 mmHg (Cal.) |
| Flash point | 224.228°C (Cal.) |
| Refractive index | 1.653 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(3,5-Dichloro-4-Methoxyphenyl)Amino]Benzoic Acid |