Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Methyl-2-Phenazinamine |
|---|---|
| Synonyms | 4-methylphenazin-2-amine |
| Molecular Structure |  |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 |
| CAS Registry Number | 100728-09-4 |
| SMILES | CC1=CC(=CC2=NC3=CC=CC=C3N=C12)N |
| InChI | 1S/C13H11N3/c1-8-6-9(14)7-12-13(8)16-11-5-3-2-4-10(11)15-12/h2-7H,14H2,1H3 |
| InChIKey | MDDNVSRPICUCAN-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.6±15.0°C at 760 mmHg (Cal.) |
| Flash point | 253.7±7.6°C (Cal.) |
| Refractive index | 1.764 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-2-Phenazinamine |