Online Database of Chemicals from Around the World
| Name | 7-Methyl-6-Methylsulfanylpurine |
|---|---|
| Synonyms | 7-Methyl-6-Methylsulfanyl-Purine; 7-Methyl-6-(Methylthio)Purine; 7H-Purine, 7-Methyl-6-(Methylthio)- |
| Molecular Structure |  |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.23 |
| CAS Registry Number | 1008-01-1 |
| SMILES | C1=NC2=C(C(=N1)SC)[N](C=N2)C |
| InChI | 1S/C7H8N4S/c1-11-4-10-6-5(11)7(12-2)9-3-8-6/h3-4H,1-2H3 |
| InChIKey | WGZQCBOLSZNNRW-UHFFFAOYSA-N |
| Density | 1.432g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.652°C at 760 mmHg (Cal.) |
| Flash point | 171.917°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methyl-6-Methylsulfanylpurine |
