Online Database of Chemicals from Around the World
|
CAS#: 100836-84-8 Product: Methyl 3,4-Dichloro-N-Nitrosocarbanilate No suppilers available for the product. |
| Name | Methyl 3,4-Dichloro-N-Nitrosocarbanilate |
|---|---|
| Synonyms | Methyl N-(3,4-Dichlorophenyl)-N-Nitroso-Carbamate; N-(3,4-Dichlorophenyl)-N-Nitrosocarbamic Acid Methyl Ester; N-(3,4-Dichlorophenyl)-N-Nitroso-Carbamic Acid Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C8H6Cl2N2O3 |
| Molecular Weight | 249.05 |
| CAS Registry Number | 100836-84-8 |
| SMILES | C1=C(C(=CC=C1N(C(OC)=O)N=O)Cl)Cl |
| InChI | 1S/C8H6Cl2N2O3/c1-15-8(13)12(11-14)5-2-3-6(9)7(10)4-5/h2-4H,1H3 |
| InChIKey | VXHDLAIYYCWDKZ-UHFFFAOYSA-N |
| Density | 1.489g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.456°C at 760 mmHg (Cal.) |
| Flash point | 158.493°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3,4-Dichloro-N-Nitrosocarbanilate |