Online Database of Chemicals from Around the World
|
CAS#: 10088-98-9 Product: Versicolorins No suppilers available for the product. |
| Name | Versicolorins |
|---|---|
| Synonyms | 1,6,8-Trihydroxy-2-Methylol-9,10-Anthraquinone; 9,10-Anthracenedione, 1,6,8-Trihydroxy-2-(Hydroxymethyl)-; Versicolorins |
| Molecular Structure |  |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.24 |
| CAS Registry Number | 10088-98-9 |
| SMILES | C1=C(O)C=C(O)C3=C1C(=O)C2=CC=C(C(=C2C3=O)O)CO |
| InChI | 1S/C15H10O6/c16-5-6-1-2-8-12(13(6)19)15(21)11-9(14(8)20)3-7(17)4-10(11)18/h1-4,16-19H,5H2 |
| InChIKey | SDVJCGYYQILFQU-UHFFFAOYSA-N |
| Density | 1.702g/cm3 (Cal.) |
|---|---|
| Boiling point | 626.627°C at 760 mmHg (Cal.) |
| Flash point | 346.782°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Versicolorins |