Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Hexagon Labs | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (609) 977-2723 | |||
|
sales@hexagonlabs.com | |||
| Chemical manufacturer since 2005 | ||||
| Name | 3-(9-Anthryl)Alanine |
|---|---|
| Synonyms | AIDS158364; AIDS-158364; NCI60_023163 |
| Molecular Structure |  |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 |
| CAS Registry Number | 100896-08-0 |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2CC(C(=O)O)N |
| InChI | 1S/C17H15NO2/c18-16(17(19)20)10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-9,16H,10,18H2,(H,19,20) |
| InChIKey | MRVJUNXMEDRMRO-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.4±38.0°C at 760 mmHg (Cal.) |
| Flash point | 258.3±26.8°C (Cal.) |
| Refractive index | 1.719 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(9-Anthryl)Alanine |