Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 5-(Hydroxymethyl)Benzene-1,2,3-Triyl Triacetate |
|---|---|
| Synonyms | 2,3-BIS(ACETYLOXY)-5-(HYDROXYMETHYL)PHENYL ACETATE; 3,4,5-TRIACETOXYBENZYL ALCOHOL; 3,4,5-Triacetoxybenzylalcohol |
| Molecular Structure |  |
| Molecular Formula | C13H14O7 |
| Molecular Weight | 282.25 |
| CAS Registry Number | 100945-24-2 |
| SMILES | O=C(Oc1c(OC(=O)C)cc(cc1OC(=O)C)CO)C |
| InChI | 1S/C13H14O7/c1-7(15)18-11-4-10(6-14)5-12(19-8(2)16)13(11)20-9(3)17/h4-5,14H,6H2,1-3H3 |
| InChIKey | RXOXLXZGIQKSOQ-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.826°C at 760 mmHg (Cal.) |
| Flash point | 141.46°C (Cal.) |
| Refractive index | 1.53 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-(Hydroxymethyl)Benzene-1,2,3-Triyl Triacetate |