Online Database of Chemicals from Around the World
|
CAS#: 100983-90-2 Product: 2-({2-[(2-Hydroxyethyl)Amino]-5-Nitrophenyl}Sulfonyl)Ethanol No suppilers available for the product. |
| Name | 2-({2-[(2-Hydroxyethyl)Amino]-5-Nitrophenyl}Sulfonyl)Ethanol |
|---|---|
| Molecular Structure | ![CAS#: 100983-90-2， 2-({2-[(2-Hydroxyethyl)Amino]-5-Nitrophenyl}Sulfonyl)Ethanol](/moreStructures/100983-90-2.gif) |
| Molecular Formula | C10H14N2O6S |
| Molecular Weight | 290.29 |
| CAS Registry Number | 100983-90-2 |
| SMILES | O=N(=O)c1ccc(NCCO)c(c1)S(=O)(=O)CCO |
| InChI | 1S/C10H14N2O6S/c13-4-3-11-9-2-1-8(12(15)16)7-10(9)19(17,18)6-5-14/h1-2,7,11,13-14H,3-6H2 |
| InChIKey | DVJPJRKJNNHZEE-UHFFFAOYSA-N |
| Density | 1.524g/cm3 (Cal.) |
|---|---|
| Boiling point | 617.876°C at 760 mmHg (Cal.) |
| Flash point | 327.48°C (Cal.) |
| Refractive index | 1.618 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-({2-[(2-Hydroxyethyl)Amino]-5-Nitrophenyl}Sulfonyl)Ethanol |