Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
|
+41 (24) 466-2929 | |||
|
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1-(2,4,4-Trimethylpentan-2-Yl)-4-[4-(2,4,4-Trimethylpentan-2-Yl)Phenoxy]Benzene |
|---|---|
| Synonyms | 1-(1,1,3,3-Tetramethylbutyl)-4-[4-(1,1,3,3-Tetramethylbutyl)Phenoxy]Benzene; Benzene, 1,1'-Oxy-, Bis[4-(1,1,3,3-Tetramethylbutyl)]-; Bis[4-(1,1,3,3-Tetramethylbutyl)Phenyl] Ether |
| Molecular Structure | ![CAS#: 101-58-6， 1-(2,4,4-Trimethylpentan-2-Yl)-4-[4-(2,4,4-Trimethylpentan-2-Yl)Phenoxy]Benzene](/moreStructures/101-58-6.gif) |
| Molecular Formula | C28H42O |
| Molecular Weight | 394.64 |
| CAS Registry Number | 101-58-6 |
| EINECS | 202-956-6 |
| SMILES | C1=C(C=CC(=C1)C(C)(C)CC(C)(C)C)OC2=CC=C(C=C2)C(C)(C)CC(C)(C)C |
| InChI | 1S/C28H42O/c1-25(2,3)19-27(7,8)21-11-15-23(16-12-21)29-24-17-13-22(14-18-24)28(9,10)20-26(4,5)6/h11-18H,19-20H2,1-10H3 |
| InChIKey | AJDONJVWDSZZQF-UHFFFAOYSA-N |
| Density | 0.927g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.339°C at 760 mmHg (Cal.) |
| Flash point | 231.422°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4,4-Trimethylpentan-2-Yl)-4-[4-(2,4,4-Trimethylpentan-2-Yl)Phenoxy]Benzene |