Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Disodium Tetrathionate |
|---|---|
| Synonyms | Tetrathionic Acid, Disodium Salt; Sodium Tetrathionate |
| Molecular Structure |  |
| Molecular Formula | H2Na2O6S4 |
| Molecular Weight | 272.23 |
| CAS Registry Number | 10101-86-7 |
| EINECS | 233-260-0 |
| SMILES | O=[S](SS[S](O)(=O)=O)(O)=O.[Na+].[Na+] |
| InChI | 1S/2Na.H2O6S4/c;;1-9(2,3)7-8-10(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1; |
| InChIKey | TYSODIVRTHAMGD-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Disodium Tetrathionate |