Online Database of Chemicals from Around the World
|
CAS#: 10112-13-7 Product: Phenyl 2,2,2-Trichloroacetate No suppilers available for the product. |
| Name | Phenyl 2,2,2-Trichloroacetate |
|---|---|
| Synonyms | 2,2,2-Trichloroacetic Acid Phenyl Ester; Phenyl 2,2,2-Trichloroethanoate; Nsc141459 |
| Molecular Structure |  |
| Molecular Formula | C8H5Cl3O2 |
| Molecular Weight | 239.49 |
| CAS Registry Number | 10112-13-7 |
| SMILES | C1=CC=CC=C1OC(C(Cl)(Cl)Cl)=O |
| InChI | 1S/C8H5Cl3O2/c9-8(10,11)7(12)13-6-4-2-1-3-5-6/h1-5H |
| InChIKey | YKSMEBWOLIJQNM-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.275°C at 760 mmHg (Cal.) |
| Flash point | 95.665°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl 2,2,2-Trichloroacetate |