Online Database of Chemicals from Around the World
|
CAS#: 10129-07-4 Product: Ethyl 4-(Phenylsulfanyl)Benzoate No suppilers available for the product. |
| Name | Ethyl 4-(Phenylsulfanyl)Benzoate |
|---|---|
| Synonyms | 4-Phenylsulfanyl-benzoic acid ethyl ester; ETHYL4-PHENYLSULFANYLBENZOATE |
| Molecular Structure |  |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 |
| CAS Registry Number | 10129-07-4 |
| SMILES | CCOC(=O)c1ccc(cc1)Sc2ccccc2 |
| InChI | 1S/C15H14O2S/c1-2-17-15(16)12-8-10-14(11-9-12)18-13-6-4-3-5-7-13/h3-11H,2H2,1H3 |
| InChIKey | MWWSTEHPUCOQQV-UHFFFAOYSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.855°C at 760 mmHg (Cal.) |
| Flash point | 193.002°C (Cal.) |
| Refractive index | 1.612 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-(Phenylsulfanyl)Benzoate |