Online Database of Chemicals from Around the World
| Leap Chem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (852) 3060-6658 | |||
 |
market19@leapchem.com | |||
 |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2022 | ||||
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
|
+41 (24) 466-2929 | |||
|
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | (2S,3S)-2-Amino-3-Hydroxy-Hexanoic Acid |
|---|---|
| Synonyms | (2S,3S)-2-Amino-3-hydroxy-hexanoic acid |
| Molecular Structure |  |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 |
| CAS Registry Number | 10148-68-2 |
| SMILES | CCC[C@@H]([C@@H](C(=O)O)N)O |
| InChI | 1S/C6H13NO3/c1-2-3-4(8)5(7)6(9)10/h4-5,8H,2-3,7H2,1H3,(H,9,10)/t4-,5-/m0/s1 |
| InChIKey | ONTYPWROJNTIRE-WHFBIAKZSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.648°C at 760 mmHg (Cal.) |
| Flash point | 152.561°C (Cal.) |
| Refractive index | 1.498 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S,3S)-2-Amino-3-Hydroxy-Hexanoic Acid |