Online Database of Chemicals from Around the World
|
CAS#: 101626-69-1 Product: Bemarinone Hydrochloride No suppilers available for the product. |
| Name | Bemarinone Hydrochloride |
|---|---|
| Synonyms | Bemarinone Hydrochloride (Usan); D03072; Bemarinone Hydrochloride |
| Molecular Structure |  |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 |
| CAS Registry Number | 101626-69-1 |
| SMILES | [H+].CC1=C2C(=NC(=O)N1)C=CC(=C2OC)OC.[Cl-] |
| InChI | 1S/C11H12N2O3.ClH/c1-6-9-7(13-11(14)12-6)4-5-8(15-2)10(9)16-3;/h4-5H,1-3H3,(H,12,13,14);1H |
| InChIKey | ZEHAPDWJZZTSOT-UHFFFAOYSA-N |
| Boiling point | 409°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 201.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bemarinone Hydrochloride |