Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-[(2-Chlorophenyl)Amino]Benzoic Acid |
|---|---|
| Synonyms | 2-(2-Chloro-phenylamino)-benzoic acid; Benzoicacid,2-[(2-chlorophenyl)amino]-; N-(2-CHLOROPHENYL)ANTHRANILICACID |
| Molecular Structure | ![CAS#: 10166-39-9， 2-[(2-Chlorophenyl)Amino]Benzoic Acid](/moreStructures/10166-39-9.gif) |
| Molecular Formula | C13H10ClNO2 |
| Molecular Weight | 247.68 |
| CAS Registry Number | 10166-39-9 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=CC=CC=C2Cl |
| InChI | 1S/C13H10ClNO2/c14-10-6-2-4-8-12(10)15-11-7-3-1-5-9(11)13(16)17/h1-8,15H,(H,16,17) |
| InChIKey | VCLVQYVABOAOBV-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.2±27.0°C at 760 mmHg (Cal.) |
| Flash point | 188.0±23.7°C (Cal.) |
| Refractive index | 1.673 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2-Chlorophenyl)Amino]Benzoic Acid |