| Nanjing Aribo Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.ariboreagent.com | |||
![]() | +86 19951442182 | |||
![]() | sales@ariboreagent.com | |||
| Chemical manufacturer since 2023 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 1-[(4-Aminophenyl)methyl]-1,2-dihydropyridin-2-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 |
| CAS Registry Number | 1017-42-1 |
| EC Number | 864-441-8 |
| SMILES | C1=CC(=O)N(C=C1)CC2=CC=C(C=C2)N |
| Solubility | 1.007e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.658, Calc.* |
| Melting point | 143.60 °C |
| Boiling Point | 381.81 °C, 463.0±28.0 °C (760 mmHg), Calc.* |
| Flash Point | 233.8±24.0 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 1-[(4-Aminophenyl)methyl]-1,2-dihydropyridin-2-one |