Online Database of Chemicals from Around the World
|
CAS#: 101810-92-8 Product: N,N',N'',N'''-(1,5-Pentanediylidene)Tetrakismethacrylamide No suppilers available for the product. |
| Name | N,N',N'',N'''-(1,5-Pentanediylidene)Tetrakismethacrylamide |
|---|---|
| Synonyms | 2-Methyl-N-[1,5,5-Tris[(2-Methyl-1-Oxoprop-2-Enyl)Amino]Pentyl]Prop-2-Enamide; 2-Methyl-N-(1,5,5-Trimethacrylamidopentyl)Acrylamide |
| Molecular Structure |  |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 |
| CAS Registry Number | 101810-92-8 |
| EINECS | 309-978-6 |
| SMILES | C(C(NC(C(C)=C)=O)NC(C(C)=C)=O)CCC(NC(C(C)=C)=O)NC(C(C)=C)=O |
| InChI | 1S/C21H32N4O4/c1-12(2)18(26)22-16(23-19(27)13(3)4)10-9-11-17(24-20(28)14(5)6)25-21(29)15(7)8/h16-17H,1,3,5,7,9-11H2,2,4,6,8H3,(H,22,26)(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | HZCZYBXRDUQHHO-UHFFFAOYSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 781.934°C at 760 mmHg (Cal.) |
| Flash point | 254.275°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N',N'',N'''-(1,5-Pentanediylidene)Tetrakismethacrylamide |