| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Proline derivatives |
|---|---|
| Name | 1-(2,4-Dinitrophenyl)-D-Proline |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11N3O6 |
| Molecular Weight | 281.22 |
| CAS Registry Number | 10189-66-9 |
| SMILES | [O-][N+](=O)c1cc(c(cc1)N2CCC[C@@H]2C(O)=O)[N+]([O-])=O |
| InChI | 1S/C11H11N3O6/c15-11(16)9-2-1-5-12(9)8-4-3-7(13(17)18)6-10(8)14(19)20/h3-4,6,9H,1-2,5H2,(H,15,16)/t9-/m1/s1 |
| InChIKey | MVZXUWLTGGBNHL-SECBINFHSA-N |
| Density | 1.563g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.023°C at 760 mmHg (Cal.) |
| Flash point | 274.953°C (Cal.) |
| Refractive index | 1.65 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dinitrophenyl)-D-Proline |