|
CAS#: 10189-94-3 Product: Bepiastine No suppilers available for the product. |
| Name | Bepiastine |
|---|---|
| Synonyms | 6-(2-Dimethylaminoethyl)-5-Pyrido[2,3-B][1,5]Benzothiazepinone; 6-(2-(Dimethylamino)Ethyl)Pyrido(2,3-B)(1,5)Benzothiazepin-5(6H)-One; 6-(2-Dimethylaminoethyl)-5,6-Dihydropyrido(2,3-B)(1,5)Benzothiazepin-5-On |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.39 |
| CAS Registry Number | 10189-94-3 |
| SMILES | C1=CC=CC2=C1N(C(C3=C(S2)N=CC=C3)=O)CCN(C)C |
| InChI | 1S/C16H17N3OS/c1-18(2)10-11-19-13-7-3-4-8-14(13)21-15-12(16(19)20)6-5-9-17-15/h3-9H,10-11H2,1-2H3 |
| InChIKey | ZEWJVHFRQFCLFW-UHFFFAOYSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.706°C at 760 mmHg (Cal.) |
| Flash point | 240.289°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bepiastine |