|
CAS#: 101909-42-6 Product: Methyl 4-Chloro-1H-Indole-3-Carboxylate No suppilers available for the product. |
| Name | Methyl 4-Chloro-1H-Indole-3-Carboxylate |
|---|---|
| Synonyms | 1H-Indole-3-carboxylic acid, 4-chloro-, methyl ester; 4-Chloro-1H-indole-3-carboxylate de méthyle; Methyl 4-chloro-1H-indole-3-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 |
| CAS Registry Number | 101909-42-6 |
| SMILES | COC(=O)c1c[nH]c2c1c(ccc2)Cl |
| InChI | 1S/C10H8ClNO2/c1-14-10(13)6-5-12-8-4-2-3-7(11)9(6)8/h2-5,12H,1H3 |
| InChIKey | FCOPGKVFHCXUKH-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.5±22.0°C at 760 mmHg (Cal.) |
| Flash point | 174.8±22.3°C (Cal.) |
| Refractive index | 1.648 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-Chloro-1H-Indole-3-Carboxylate |